Tauromurocholate

ID: ALA2074892

PubChem CID: 13955657

Max Phase: Preclinical

Molecular Formula: C26H45NO6S

Molecular Weight: 499.71

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Tauromurocholate | TAUROMUROCHOLATE|CHEMBL2074892|CHEBI:182389|'2-((4R)-4-((3R,5R,6R,8S,9S,10R,13R,17R)-3,6-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamido)ethane-1-sulfonic acid'|2-[[(4R)-4-[(3R,5R,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulonic acid

Canonical SMILES:  C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C26H45NO6S/c1-16(4-7-24(30)27-12-13-34(31,32)33)19-5-6-20-18-15-23(29)22-14-17(28)8-10-26(22,3)21(18)9-11-25(19,20)2/h16-23,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17-,18+,19-,20+,21+,22+,23-,25-,26-/m1/s1

Standard InChI Key:  HMXPOCDLAFAFNT-CZNXQHJVSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -0.3265    6.3838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8329    5.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5220    4.9683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6501    5.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1565    5.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9737    5.3069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4801    4.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2508    3.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9336    3.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5850    3.9064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3047    4.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9448    5.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8365    5.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6486    5.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9289    4.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3971    3.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6774    2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4895    2.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7698    2.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0213    3.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8334    3.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3653    3.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1774    3.8110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0850    4.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2728    4.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7410    4.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4607    5.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2846    6.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2749    4.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4884    3.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2853    3.7444    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6978    3.0299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2853    4.5694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1103    3.7444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3611    2.5303    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7525    2.9967    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5735    5.1564    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8245    2.9355    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4980    4.4671    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 10 11  1  0
  7 11  1  0
 11 12  1  1
 11 13  1  0
 13 14  1  0
 15 14  1  0
 15 16  1  0
 10 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  1
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  6
 22 24  1  0
 24 25  1  0
 25 26  1  0
 20 26  1  0
 15 26  1  0
 26 27  1  1
  6 28  1  6
  3 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 31 34  2  0
 20 35  1  1
 16 36  1  1
 15 37  1  6
 10 38  1  6
  7 39  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA2074892

   TAUROMUROCHOLATE

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 499.71

Molecular Weight (Monoisotopic): 499.2968

AlogP: 3.40

#Rotatable Bonds: 7

Polar Surface Area: 123.93

Molecular Species: ACID

HBA: 5

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: -0.72

CX Basic pKa: ┄

CX LogP: 1.19

CX LogD: -0.23

Aromatic Rings: ┄

Heavy Atoms: 34

QED Weighted: 0.40

Np Likeness Score: 1.81

References

1. Hata S, Wang P, Eftychiou N, Ananthanarayanan M, Batta A, Salen G, Pang KS, Wolkoff AW..  (2003)  Substrate specificities of rat oatp1 and ntcp: implications for hepatic organic anion uptake.,  285  (1): [PMID:12842829] [10.1152/ajpgi.00352.2002]

2.  (1999)  TP-search Transporter Database,  30  (1):

Source

Source(1):

• TP-search Transporter Database