The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Thyroxine sulfamate ID: ALA2074911
PubChem CID: 70693177
Max Phase: Preclinical
Molecular Formula: C15H14I4N2O7S
Molecular Weight: 873.97
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Thyroxine sulfamate | THYROXINE SULFAMATE|CHEMBL2074911
Canonical SMILES: NS(=O)(=O)O.N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)O
Standard InChI: InChI=1S/C15H11I4NO4.H3NO3S/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;1-5(2,3)4/h1-2,4-5,12,21H,3,20H2,(H,22,23);(H3,1,2,3,4)/t12-;/m0./s1
Standard InChI Key: VZIJPBFIKKZOCM-YDALLXLXSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
4.0955 2.2688 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2705 2.2688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9205 2.2688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0955 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0955 3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8336 1.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5480 0.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5480 0.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8336 -0.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 0.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 0.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8336 2.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 2.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 3.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 -1.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1191 -2.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 -2.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3098 -2.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3098 -1.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 -1.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 2.1512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8336 -1.1488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0243 -2.7988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 3.8012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8336 3.8012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2625 -0.3238 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 -3.6238 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
-0.5954 -0.3238 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
-2.0243 -1.1488 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
1 5 2 0
6 7 2 0
6 11 1 0
6 12 1 0
7 8 1 0
8 9 2 0
8 26 1 0
9 10 1 0
9 22 1 0
10 11 2 0
10 28 1 0
12 13 1 0
13 14 1 0
13 21 1 6
14 24 2 0
14 25 1 0
15 16 2 0
15 20 1 0
15 22 1 0
16 17 1 0
17 18 2 0
17 27 1 0
18 19 1 0
18 23 1 0
19 20 2 0
19 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 873.97Molecular Weight (Monoisotopic): 873.6701AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Friesema EC, Docter R, Moerings EP, Stieger B, Hagenbuch B, Meier PJ, Krenning EP, Hennemann G, Visser TJ.. (1999) Identification of thyroid hormone transporters., 254 (1): [PMID:9918867 ] [10.1006/bbrc.1998.9974 ]