The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Taurotrihydroxycoprostanoic acid ID: ALA2074912
PubChem CID: 70691032
Max Phase: Preclinical
Molecular Formula: C30H51NO9S
Molecular Weight: 601.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Taurotrihydroxycoprostanoic acid | CHEMBL2074912|TAUROTRIHYDROXYCOPROSTANOIC ACID
Canonical SMILES: CC(CCC[C@@H](C)C1CC[C@H]2[C@@H]3[C@H](O)C[C@]4(C(=O)O)C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C)C(=O)NCCS(=O)(=O)O
Standard InChI: InChI=1S/C30H51NO9S/c1-17(6-5-7-18(2)26(35)31-12-13-41(38,39)40)20-8-9-21-25-22(14-24(34)29(20,21)4)28(3)11-10-19(32)15-30(28,27(36)37)16-23(25)33/h17-25,32-34H,5-16H2,1-4H3,(H,31,35)(H,36,37)(H,38,39,40)/t17-,18?,19-,20?,21+,22+,23-,24+,25+,28-,29-,30+/m1/s1
Standard InChI Key: PHTARZWWYRIHDQ-QNSVROIYSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
5.3404 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -21.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0549 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -21.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -19.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -18.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -19.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2684 -20.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7533 -19.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2684 -18.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5233 -18.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9713 -17.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3303 -17.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5853 -17.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3922 -16.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -18.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -19.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1969 -21.5973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -22.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -22.4223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -22.4223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -21.5973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -17.8848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6472 -16.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4542 -15.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0952 -15.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7091 -15.2143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0062 -16.6120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8132 -16.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3652 -17.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1722 -16.8821 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.7242 -17.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9586 -16.0852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8866 -16.4696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5883 -20.9418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6353 -20.8598 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.1888 -19.4473 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
6 5 1 0
1 7 1 0
6 1 1 0
10 6 1 0
8 9 1 0
9 10 1 0
8 14 1 0
8 7 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 6
18 20 1 0
20 21 1 0
21 22 1 0
13 23 1 1
1 24 1 1
4 25 1 6
6 26 1 1
26 27 1 0
26 28 2 0
9 29 1 6
12 30 1 6
22 31 1 0
31 32 1 0
31 33 1 0
32 34 2 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
38 41 2 0
14 42 1 6
8 43 1 1
7 44 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.80Molecular Weight (Monoisotopic): 601.3285AlogP: 2.85#Rotatable Bonds: 10Polar Surface Area: 181.46Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.77CX Basic pKa: ┄CX LogP: 0.85CX LogD: -3.46Aromatic Rings: ┄Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: 1.81
References 1. Hata S, Wang P, Eftychiou N, Ananthanarayanan M, Batta A, Salen G, Pang KS, Wolkoff AW.. (2003) Substrate specificities of rat oatp1 and ntcp: implications for hepatic organic anion uptake., 285 (1): [PMID:12842829 ] [10.1152/ajpgi.00352.2002 ]