The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tauro-23-norcholate ID: ALA2074913
PubChem CID: 70697262
Max Phase: Preclinical
Molecular Formula: C25H43NO7S
Molecular Weight: 501.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
Standard InChI: InChI=1S/C25H43NO7S/c1-14(10-22(30)26-8-9-34(31,32)33)17-4-5-18-23-19(13-21(29)25(17,18)3)24(2)7-6-16(27)11-15(24)12-20(23)28/h14-21,23,27-29H,4-13H2,1-3H3,(H,26,30)(H,31,32,33)/t14-,15+,16-,17-,18+,19+,20-,21+,23+,24+,25-/m1/s1
Standard InChI Key: FLCYLDUFOVBENV-SRNOMOOLSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-2.4571 -0.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2040 -0.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2739 -1.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0208 -1.8197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5969 -1.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8501 -1.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1732 -2.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4263 -1.7115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2506 -2.1831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3564 -0.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0333 -0.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7801 -0.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9634 0.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2165 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1466 1.5766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4604 0.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3904 -0.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1507 -0.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6904 -0.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2638 0.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6159 1.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7102 0.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5844 1.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0863 1.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4029 1.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8154 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6404 0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4029 -0.0956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0529 -0.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8779 -0.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2904 -0.8101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.1154 -0.8101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4654 -0.8101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2904 -1.6351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2612 0.5427 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4103 -1.5388 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8539 0.1537 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4642 -1.4611 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.9349 -2.5868 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 12 1 0
2 3 1 0
3 4 1 6
3 5 1 0
6 5 1 0
6 7 1 0
12 6 1 0
7 8 1 0
8 9 1 6
8 10 1 0
10 11 1 0
10 17 1 0
12 11 1 0
11 13 1 0
12 22 1 1
13 14 1 0
14 15 1 6
14 16 1 0
16 17 1 0
16 20 1 0
16 21 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 23 1 0
23 24 1 6
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 2 0
31 34 1 0
20 35 1 6
17 36 1 6
11 37 1 6
10 38 1 1
6 39 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.69Molecular Weight (Monoisotopic): 501.2760AlogP: 1.98#Rotatable Bonds: 6Polar Surface Area: 144.16Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: -0.87CX Basic pKa: ┄CX LogP: -0.76CX LogD: -1.90Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: 2.05
References 1. Hata S, Wang P, Eftychiou N, Ananthanarayanan M, Batta A, Salen G, Pang KS, Wolkoff AW.. (2003) Substrate specificities of rat oatp1 and ntcp: implications for hepatic organic anion uptake., 285 (1): [PMID:12842829 ] [10.1152/ajpgi.00352.2002 ]