The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Nalpha-sulfonated thyroxine ID: ALA2074954
PubChem CID: 70691034
Max Phase: Preclinical
Molecular Formula: C15H11I4NO7S
Molecular Weight: 856.94
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)[C@@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)NS(=O)(=O)O
Standard InChI: InChI=1S/C15H11I4NO7S/c16-8-4-7(5-9(17)13(8)21)27-14-10(18)1-6(2-11(14)19)3-12(15(22)23)20-28(24,25)26/h1-2,4-5,12,20-21H,3H2,(H,22,23)(H,24,25,26)/t12-/m1/s1
Standard InChI Key: WDZGBBVWVGSPGU-GFCCVEGCSA-N
Molfile:
RDKit 2D
28 29 0 0 1 0 0 0 0 0999 V2000
4.5812 -3.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7330 -4.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4536 -4.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7330 -3.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5812 -4.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2905 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1571 -3.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8663 -2.8369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1501 -4.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4422 -2.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1629 -4.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0054 -4.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4352 -4.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0054 -3.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2905 -4.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7146 -4.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1501 -5.3076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0181 -2.8369 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
2.4422 -5.3076 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
5.2847 -2.0133 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
3.8663 -4.4954 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1.0181 -4.4840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4295 -3.2487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8594 -4.0722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1440 -2.8362 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.9408 -3.0497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5606 -2.2528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5565 -2.1217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 11 2 0
4 10 1 0
5 1 2 0
6 1 1 0
7 8 1 0
8 1 1 0
9 13 1 0
10 7 2 0
11 7 1 0
12 14 1 0
13 16 1 0
14 6 2 0
15 5 1 0
16 12 1 0
17 9 2 0
18 4 1 0
19 3 1 0
20 6 1 0
21 5 1 0
22 2 1 0
13 23 1 1
24 9 1 0
12 15 2 0
2 4 2 0
23 25 1 0
25 26 1 0
25 27 2 0
25 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 856.94Molecular Weight (Monoisotopic): 856.6435AlogP: 3.99#Rotatable Bonds: 7Polar Surface Area: 133.16Molecular Species: ACIDHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.96CX Basic pKa: ┄CX LogP: 3.59CX LogD: -0.76Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.24Np Likeness Score: 0.26
References 1. Friesema EC, Ganguly S, Abdalla A, Manning Fox JE, Halestrap AP, Visser TJ.. (2003) Identification of monocarboxylate transporter 8 as a specific thyroid hormone transporter., 278 (1): [PMID:12871948 ] [10.1074/jbc.m300909200 ]