The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Trihydroxycoprostanoic acid ID: ALA2074975
PubChem CID: 70693178
Max Phase: Preclinical
Molecular Formula: C28H48O5
Molecular Weight: 464.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Trihydroxycoprostanoic acid | Trihydroxycoprostanoic acid|CHEMBL2074975
Canonical SMILES: CC(C)CCC[C@@H](C)C1CC[C@H]2[C@@H]3[C@H](O)C[C@]4(C(=O)O)C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
Standard InChI: InChI=1S/C28H48O5/c1-16(2)7-6-8-17(3)19-9-10-20-24-21(13-23(31)27(19,20)5)26(4)12-11-18(29)14-28(26,25(32)33)15-22(24)30/h16-24,29-31H,6-15H2,1-5H3,(H,32,33)/t17-,18-,19?,20+,21+,22-,23+,24+,26-,27-,28+/m1/s1
Standard InChI Key: JIFNDZCDNLFAKC-FUMCEKOBSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
5.3404 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -21.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0549 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -20.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -21.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -21.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -19.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -18.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -19.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2684 -20.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7533 -19.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2684 -18.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5233 -18.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9713 -17.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3303 -17.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5853 -17.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3922 -16.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -18.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -19.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1969 -21.5973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3404 -22.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -22.4223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -22.4223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4838 -21.5973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7693 -17.8848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6472 -16.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4542 -15.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0952 -15.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5883 -20.9418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6353 -20.8598 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.1888 -19.4473 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
6 5 1 0
1 7 1 0
6 1 1 0
10 6 1 0
8 9 1 0
9 10 1 0
8 14 1 0
8 7 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 6
18 20 1 0
20 21 1 0
21 22 1 0
13 23 1 1
1 24 1 1
4 25 1 6
6 26 1 1
26 27 1 0
26 28 2 0
9 29 1 6
12 30 1 6
22 31 1 0
31 32 1 0
31 33 1 0
14 34 1 6
8 35 1 1
7 36 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.69Molecular Weight (Monoisotopic): 464.3502AlogP: 4.87#Rotatable Bonds: 6Polar Surface Area: 97.99Molecular Species: ACIDHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.35CX Basic pKa: ┄CX LogP: 4.47CX LogD: 1.55Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: 2.34
References 1. Hata S, Wang P, Eftychiou N, Ananthanarayanan M, Batta A, Salen G, Pang KS, Wolkoff AW.. (2003) Substrate specificities of rat oatp1 and ntcp: implications for hepatic organic anion uptake., 285 (1): [PMID:12842829 ] [10.1152/ajpgi.00352.2002 ]