The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Glyco-23-norcholate ID: ALA2074976
PubChem CID: 70686874
Max Phase: Preclinical
Molecular Formula: C25H41NO6
Molecular Weight: 451.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
Standard InChI: InChI=1S/C25H41NO6/c1-13(8-21(30)26-12-22(31)32)16-4-5-17-23-18(11-20(29)25(16,17)3)24(2)7-6-15(27)9-14(24)10-19(23)28/h13-20,23,27-29H,4-12H2,1-3H3,(H,26,30)(H,31,32)/t13-,14+,15-,16-,17+,18+,19-,20+,23+,24+,25-/m1/s1
Standard InChI Key: KISULFZDFZHQPA-KOEFMKPHSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-5.0605 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7750 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4895 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4895 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7750 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0605 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3460 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3460 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3460 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9171 1.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9171 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1325 0.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6476 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1325 1.4925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0605 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0605 -1.8250 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-7.2040 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2120 0.9125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9171 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7656 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.8125 -0.5819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9171 2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 2.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8775 2.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4296 2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0706 2.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6581 1.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1669 1.7342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0706 1.0197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5794 1.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4044 1.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8169 0.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8169 1.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1448 1.6489 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
10 6 1 0
6 1 1 0
1 7 1 0
8 9 1 0
9 10 1 0
7 11 1 0
8 7 1 0
14 8 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 16 1 0
1 18 1 1
6 19 1 1
4 20 1 6
7 21 1 6
9 22 1 6
8 23 1 1
14 24 1 6
13 25 1 1
12 26 1 6
17 27 1 0
27 28 1 6
27 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
17 37 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.60Molecular Weight (Monoisotopic): 451.2934AlogP: 2.17#Rotatable Bonds: 5Polar Surface Area: 127.09Molecular Species: ACIDHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.91CX Basic pKa: ┄CX LogP: 0.93CX LogD: -2.28Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: 2.20
References 1. Hata S, Wang P, Eftychiou N, Ananthanarayanan M, Batta A, Salen G, Pang KS, Wolkoff AW.. (2003) Substrate specificities of rat oatp1 and ntcp: implications for hepatic organic anion uptake., 285 (1): [PMID:12842829 ] [10.1152/ajpgi.00352.2002 ]