The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Corticosterone-21-sulfate ID: ALA2075012
Cas Number: 1105-02-8
PubChem CID: 193324
Max Phase: Preclinical
Molecular Formula: C21H30O7S
Molecular Weight: 426.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)COS(=O)(=O)O
Standard InChI: InChI=1S/C21H30O7S/c1-20-8-7-13(22)9-12(20)3-4-14-15-5-6-16(18(24)11-28-29(25,26)27)21(15,2)10-17(23)19(14)20/h9,14-17,19,23H,3-8,10-11H2,1-2H3,(H,25,26,27)/t14-,15-,16+,17-,19+,20-,21-/m0/s1
Standard InChI Key: DWEMVKUDQCSHGT-HJTSIMOOSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-14.1060 2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8205 3.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5350 2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5350 2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.8205 1.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1061 2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3916 3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6771 2.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6771 2.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3916 1.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3916 4.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6771 4.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.9627 4.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.9626 3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1781 3.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6931 3.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1780 4.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9231 5.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4751 5.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1161 5.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5327 4.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.7359 4.9368 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.9390 5.1504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.9494 5.7337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.5223 4.1399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.9627 4.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6771 3.6831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-11.9626 2.4456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-13.3916 2.4456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-14.1060 3.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.2495 1.6205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.1061 4.5080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
10 6 1 0
6 1 1 0
1 7 1 0
8 9 1 0
9 10 1 0
7 11 1 0
8 7 1 0
14 8 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 16 1 0
17 18 1 1
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
22 25 2 0
13 26 1 1
8 27 1 1
14 28 1 6
7 29 1 6
1 30 1 1
4 31 2 0
11 32 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.53Molecular Weight (Monoisotopic): 426.1712AlogP: 2.49#Rotatable Bonds: 4Polar Surface Area: 117.97Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.59CX Basic pKa: ┄CX LogP: 0.54CX LogD: -0.30Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.66Np Likeness Score: 2.14
References 1. Kanai N, Lu R, Bao Y, Wolkoff AW, Vore M, Schuster VL.. (1996) Estradiol 17 beta-D-glucuronide is a high-affinity substrate for oatp organic anion transporter., 270 (1): [PMID:8779894 ] [10.1152/ajprenal.1996.270.2.f326 ]