1-(4-butylphenyl)-4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)butan-1-one

ID: ALA207832

PubChem CID: 44411202

Max Phase: Preclinical

Molecular Formula: C32H39NO2

Molecular Weight: 469.67

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1ccc(C(=O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1

Standard InChI:  InChI=1S/C32H39NO2/c1-2-3-11-26-17-19-27(20-18-26)31(34)16-10-23-33-24-21-30(22-25-33)32(35,28-12-6-4-7-13-28)29-14-8-5-9-15-29/h4-9,12-15,17-20,30,35H,2-3,10-11,16,21-25H2,1H3

Standard InChI Key:  QGDPYJHGPFUYJB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -5.3250  -15.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5000  -15.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6750  -15.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5000  -14.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5000  -16.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7853  -14.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7849  -13.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4999  -13.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2168  -13.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2136  -14.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2147  -16.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2151  -17.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5001  -18.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7832  -17.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7864  -16.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2637  -16.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4423  -16.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0260  -15.6348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4372  -14.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2649  -14.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2010  -15.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7912  -16.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0338  -16.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4436  -17.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2686  -17.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0284  -17.7860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6742  -17.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4985  -17.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9145  -17.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5003  -16.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6774  -16.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7395  -17.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1502  -17.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9752  -17.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3860  -18.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  2  5  1  0
  9 10  2  0
  3 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 10  4  1  0
 18 21  1  0
  2  3  1  0
 21 22  1  0
  5 11  2  0
 22 23  1  0
  4  6  2  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  1  2  1  0
 24 26  2  0
 12 13  2  0
 25 27  2  0
  6  7  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
  2  4  1  0
 29 30  1  0
 14 15  2  0
 30 31  2  0
 31 25  1  0
 15  5  1  0
 29 32  1  0
  3 16  1  0
 32 33  1  0
  7  8  2  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

CYP2J2 Tchem Cytochrome P450 2J2 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.67Molecular Weight (Monoisotopic): 469.2981AlogP: 6.64#Rotatable Bonds: 11
Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: 8.41CX LogP: 6.87CX LogD: 5.82
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.50

References

1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D..  (2006)  Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2.,  16  (10): [PMID:16495056] [10.1016/j.bmcl.2006.02.004]

Source