The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(3-chloropyridin-4-yl)-6,8-difluoro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)-N-cyclopropyl-5-fluoro-4-methylbenzamide ID: ALA2087745
PubChem CID: 25060096
Max Phase: Preclinical
Molecular Formula: C22H15ClF3N5O
Molecular Weight: 457.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(F)cc(C(=O)NC2CC2)cc1-c1c(F)cn2c(-c3ccncc3Cl)nnc2c1F
Standard InChI: InChI=1S/C22H15ClF3N5O/c1-10-14(6-11(7-16(10)24)22(32)28-12-2-3-12)18-17(25)9-31-20(29-30-21(31)19(18)26)13-4-5-27-8-15(13)23/h4-9,12H,2-3H2,1H3,(H,28,32)
Standard InChI Key: MOYJHWSRAAKSSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-3.7848 1.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7860 0.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0703 0.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3531 0.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3560 1.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0721 2.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6422 2.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9254 1.8027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6454 3.0389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2117 2.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6131 2.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1974 2.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5016 0.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0705 -0.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7912 -0.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3629 -1.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3589 -0.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0801 -1.9221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7905 -1.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4060 -2.0525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0761 -2.8070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2571 -2.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8233 -3.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6433 -0.2695 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5051 -0.2674 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5002 2.2065 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2124 -4.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7793 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9575 -4.8152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5707 -4.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0060 -3.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0379 -4.1698 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
7 8 1 0
14 17 1 0
15 19 1 0
18 16 1 0
16 17 2 0
18 19 1 0
7 9 2 0
4 5 1 0
8 10 1 0
11 10 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 18 1 0
12 11 1 0
22 23 1 0
10 12 1 0
17 24 1 0
2 3 1 0
15 25 1 0
5 6 2 0
1 26 1 0
6 1 1 0
23 27 2 0
2 13 1 0
27 28 1 0
1 2 2 0
28 29 2 0
3 14 1 0
29 30 1 0
14 15 2 0
30 31 2 0
31 23 1 0
5 7 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.84Molecular Weight (Monoisotopic): 457.0917AlogP: 4.73#Rotatable Bonds: 4Polar Surface Area: 72.18Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.21CX LogP: 3.34CX LogD: 3.34Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.40
References 1. Aiguadé J, Balagué C, Carranco I, Caturla F, Domínguez M, Eastwood P, Esteve C, González J, Lumeras W, Orellana A, Preciado S, Roca R, Vidal L, Vidal B.. (2012) Novel triazolopyridylbenzamides as potent and selective p38α inhibitors., 22 (10): [PMID:22521646 ] [10.1016/j.bmcl.2012.03.099 ]