The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyclopropyl-3-(3-(2-(dimethylamino)propan-2-yl)-6,8-difluoro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)-5-fluoro-4-methylbenzamide ID: ALA2087747
PubChem CID: 59320154
Max Phase: Preclinical
Molecular Formula: C22H24F3N5O
Molecular Weight: 431.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(F)cc(C(=O)NC2CC2)cc1-c1c(F)cn2c(C(C)(C)N(C)C)nnc2c1F
Standard InChI: InChI=1S/C22H24F3N5O/c1-11-14(8-12(9-15(11)23)20(31)26-13-6-7-13)17-16(24)10-30-19(18(17)25)27-28-21(30)22(2,3)29(4)5/h8-10,13H,6-7H2,1-5H3,(H,26,31)
Standard InChI Key: PTXRXMIWYZJYGZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
10.8402 1.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8391 1.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5539 0.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2703 1.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2675 1.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5521 2.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9804 2.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6964 1.9549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9773 3.1897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4093 2.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2332 2.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8181 3.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1243 0.7066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5537 -0.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8339 -0.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2607 -1.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2645 -0.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5443 -1.7657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8347 -1.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2198 -1.8961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5494 -2.6497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3675 -2.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8007 -3.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9793 -0.1151 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1208 -0.1129 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1257 2.3582 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4118 -3.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6253 -3.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2083 -3.9750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7945 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0333 -3.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 7 1 0
3 4 2 0
7 8 1 0
14 17 1 0
15 19 1 0
18 16 1 0
16 17 2 0
18 19 1 0
7 9 2 0
4 5 1 0
8 10 1 0
11 10 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 18 1 0
12 11 1 0
22 23 1 0
10 12 1 0
17 24 1 0
2 3 1 0
15 25 1 0
5 6 2 0
1 26 1 0
6 1 1 0
23 27 1 0
2 13 1 0
23 28 1 0
1 2 2 0
23 29 1 0
3 14 1 0
29 30 1 0
14 15 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.46Molecular Weight (Monoisotopic): 431.1933AlogP: 3.81#Rotatable Bonds: 5Polar Surface Area: 62.53Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.03CX LogP: 2.94CX LogD: 2.79Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -1.17
References 1. Aiguadé J, Balagué C, Carranco I, Caturla F, Domínguez M, Eastwood P, Esteve C, González J, Lumeras W, Orellana A, Preciado S, Roca R, Vidal L, Vidal B.. (2012) Novel triazolopyridylbenzamides as potent and selective p38α inhibitors., 22 (10): [PMID:22521646 ] [10.1016/j.bmcl.2012.03.099 ]