7-(2-fluorophenyl)-2-((2-methyl-2H-1,2,4-triazol-3-yl)methoxy)-3-(3-(trifluoromethyl)phenyl)pyrazolo[1,5-d][1,2,4]triazine

ID: ALA208844

PubChem CID: 18406840

Max Phase: Preclinical

Molecular Formula: C22H15F4N7O

Molecular Weight: 469.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1ncnc1COc1nn2c(-c3ccccc3F)nncc2c1-c1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C22H15F4N7O/c1-32-18(27-12-29-32)11-34-21-19(13-5-4-6-14(9-13)22(24,25)26)17-10-28-30-20(33(17)31-21)15-7-2-3-8-16(15)23/h2-10,12H,11H2,1H3

Standard InChI Key:  ZHPXUSDIAXKCGY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   15.8526  -14.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0362  -14.9695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9190  -15.7862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6596  -16.1500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2343  -15.5580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0506  -15.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5592  -10.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9904  -11.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9872  -10.5476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2690  -10.1388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2710  -11.7922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5566  -11.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9400  -11.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2734  -12.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0959  -12.6002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8581  -13.3965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2240  -11.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2268  -10.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5119  -10.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7977  -10.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8030  -11.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5186  -11.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7053  -11.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7039  -12.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4180  -13.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1331  -12.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1296  -11.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4150  -11.3766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4113  -10.5516    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.2679  -14.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0912  -11.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3759  -12.3530    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.5662  -12.6610    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6767  -11.2019    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 11  8  1  0
 13 17  1  0
  3  4  2  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
 10  7  2  0
 21 22  2  0
 22 17  1  0
 11 12  1  0
  8 23  1  0
  5  1  1  0
 23 24  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  7 12  1  0
 27 28  2  0
 28 23  1  0
 12 13  2  0
 28 29  1  0
 13 14  1  0
 16 30  1  0
 30  1  1  0
 14 15  2  0
 21 31  1  0
 15 11  1  0
 31 32  1  0
  2  3  1  0
 31 33  1  0
 14 16  1  0
 31 34  1  0
M  END

Associated Targets(Human)

GABRG2 Tclin GABA-A receptor; alpha-3/beta-3/gamma-2 (1250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA-A receptor; alpha-1/beta-3/gamma-2 (1565 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.40Molecular Weight (Monoisotopic): 469.1274AlogP: 4.32#Rotatable Bonds: 5
Polar Surface Area: 83.02Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.08CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.74

References

1. Carling RW, Russell MG, Moore KW, Mitchinson A, Guiblin A, Smith A, Wafford KA, Marshall G, Atack JR, Street LJ..  (2006)  2,3,7-Trisubstituted pyrazolo[1,5-d][1,2,4]triazines: functionally selective GABAA alpha3-subtype agonists.,  16  (13): [PMID:16621541] [10.1016/j.bmcl.2006.03.081]

Source