The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-{[4-(4-fluoro-phenylamino)-6-piperidin-1-yl-[1,3,5]triazin-2-yl]-hydrazonomethyl}-2-methoxy-phenoxy)-acetic acid ID: ALA209055
Max Phase: Preclinical
Molecular Formula: C24H26FN7O4
Molecular Weight: 495.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/Nc2nc(Nc3ccc(F)cc3)nc(N3CCCCC3)n2)ccc1OCC(=O)O
Standard InChI: InChI=1S/C24H26FN7O4/c1-35-20-13-16(5-10-19(20)36-15-21(33)34)14-26-31-23-28-22(27-18-8-6-17(25)7-9-18)29-24(30-23)32-11-3-2-4-12-32/h5-10,13-14H,2-4,11-12,15H2,1H3,(H,33,34)(H2,27,28,29,30,31)/b26-14+
Standard InChI Key: SFLXZAPPMTUXAE-VULFUBBASA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
1.9362 -6.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1829 -6.4442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5150 -6.9298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1875 -6.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1622 -5.6734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8639 -5.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5908 -5.6330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6116 -6.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9093 -6.8909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3362 -6.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8402 -4.4162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1140 -4.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5836 -4.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 -4.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3335 -3.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6261 -2.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0966 -3.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6689 -6.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3616 -6.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0938 -6.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1324 -5.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4327 -5.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7032 -5.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4679 -4.3744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8647 -5.2638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1993 -3.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5600 -5.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2923 -5.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9877 -5.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3293 -4.5037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0591 -2.8514 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.0396 -6.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7619 -6.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7866 -7.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0827 -8.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3542 -7.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 2 0
1 18 1 0
9 4 1 0
18 19 2 0
4 5 2 0
19 20 1 0
8 10 1 0
20 21 2 0
2 3 1 0
21 22 1 0
6 11 1 0
22 23 2 0
23 18 1 0
5 6 1 0
22 24 1 0
11 12 1 0
21 25 1 0
1 2 2 0
24 26 1 0
12 13 2 0
25 27 1 0
6 7 2 0
27 28 1 0
13 14 1 0
28 29 1 0
3 4 1 0
28 30 2 0
14 15 2 0
15 31 1 0
10 32 1 0
7 8 1 0
15 16 1 0
16 17 2 0
17 12 1 0
10 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.52Molecular Weight (Monoisotopic): 495.2030AlogP: 3.66#Rotatable Bonds: 10Polar Surface Area: 134.09Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.18CX Basic pKa: 5.07CX LogP: 3.60CX LogD: 1.97Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -1.58
References 1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N.. (2006) Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents., 49 (15): [PMID:16854058 ] [10.1021/jm051296s ] 2. Al-Nadaf A, Abu Sheikha G, Taha MO.. (2010) Elaborate ligand-based pharmacophore exploration and QSAR analysis guide the synthesis of novel pyridinium-based potent beta-secretase inhibitory leads., 18 (9): [PMID:20378363 ] [10.1016/j.bmc.2010.03.043 ]