7-(4-(4-acetamidophenylsulfonyl)piperazin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA209101

PubChem CID: 1361354

Max Phase: Preclinical

Molecular Formula: C24H25FN4O6S

Molecular Weight: 516.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(S(=O)(=O)c4ccc(NC(C)=O)cc4)CC3)cc21

Standard InChI:  InChI=1S/C24H25FN4O6S/c1-3-27-14-19(24(32)33)23(31)18-12-20(25)22(13-21(18)27)28-8-10-29(11-9-28)36(34,35)17-6-4-16(5-7-17)26-15(2)30/h4-7,12-14H,3,8-11H2,1-2H3,(H,26,30)(H,32,33)

Standard InChI Key:  ONXIXHMYSNAGEX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   -2.3674  -15.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5400  -15.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1279  -14.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5421  -13.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3726  -13.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7809  -14.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6059  -14.7051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0214  -13.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8464  -13.9957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6118  -13.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3029  -14.6973    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.5194  -14.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3066  -13.8760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3089  -15.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9189  -15.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7376  -15.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1585  -14.7212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7546  -14.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9297  -13.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9835  -14.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3842  -15.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2222  -14.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994  -14.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6304  -14.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2066  -15.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6076  -16.1782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4322  -16.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8541  -15.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4507  -14.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8714  -14.0524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1846  -16.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3597  -16.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6791  -15.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0874  -16.2049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1028  -14.7760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9925  -13.3053    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  4  5  2  0
 17 20  1  0
  8 10  1  0
 20 21  2  0
 21 25  1  0
  2  3  2  0
 24 22  1  0
  3 11  1  0
 22 23  2  0
 23 20  1  0
  5  6  1  0
 11 12  1  0
 24 25  2  0
  6  1  2  0
 25 26  1  0
 11 13  2  0
 26 27  1  0
  1  2  1  0
 27 28  2  0
 11 14  2  0
 28 29  1  0
 29 24  1  0
 12 15  1  0
 29 30  2  0
  6  7  1  0
 26 31  1  0
  3  4  1  0
 31 32  1  0
  7  8  1  0
 28 33  1  0
  8  9  2  0
 33 34  1  0
 33 35  2  0
 12 19  1  0
 23 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA209101

   7-[4-(4-Acetamidophenyl)sulfonyl-1-piperazinyl]-1-ethyl-6-fluoro-4-oxo-3-quinolinecarboxylic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 516.55

Molecular Weight (Monoisotopic): 516.1479

AlogP: 2.33

#Rotatable Bonds: 6

Polar Surface Area: 129.02

Molecular Species: ACID

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 5.88

CX Basic pKa: ┄

CX LogP: 1.90

CX LogD: 0.37

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.51

Np Likeness Score: -1.62

References

1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N..  (2006)  Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents.,  49  (15): [PMID:16854058] [10.1021/jm051296s]

2. PubChem BioAssay data set, 

Source

Source(2):

• Scientific Literature
• PubChem BioAssays