The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(4-acetamidophenylsulfonyl)piperazin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA209101
PubChem CID: 1361354
Max Phase: Preclinical
Molecular Formula: C24H25FN4O6S
Molecular Weight: 516.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(S(=O)(=O)c4ccc(NC(C)=O)cc4)CC3)cc21
Standard InChI: InChI=1S/C24H25FN4O6S/c1-3-27-14-19(24(32)33)23(31)18-12-20(25)22(13-21(18)27)28-8-10-29(11-9-28)36(34,35)17-6-4-16(5-7-17)26-15(2)30/h4-7,12-14H,3,8-11H2,1-2H3,(H,26,30)(H,32,33)
Standard InChI Key: ONXIXHMYSNAGEX-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-2.3674 -15.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5400 -15.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1279 -14.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5421 -13.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3726 -13.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7809 -14.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6059 -14.7051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0214 -13.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8464 -13.9957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6118 -13.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3029 -14.6973 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5194 -14.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3066 -13.8760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3089 -15.5260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9189 -15.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7376 -15.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1585 -14.7212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7546 -14.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9297 -13.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9835 -14.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3842 -15.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2222 -14.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3994 -14.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6304 -14.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2066 -15.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6076 -16.1782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4322 -16.1904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8541 -15.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4507 -14.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8714 -14.0524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1846 -16.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3597 -16.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6791 -15.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0874 -16.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1028 -14.7760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9925 -13.3053 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
4 5 2 0
17 20 1 0
8 10 1 0
20 21 2 0
21 25 1 0
2 3 2 0
24 22 1 0
3 11 1 0
22 23 2 0
23 20 1 0
5 6 1 0
11 12 1 0
24 25 2 0
6 1 2 0
25 26 1 0
11 13 2 0
26 27 1 0
1 2 1 0
27 28 2 0
11 14 2 0
28 29 1 0
29 24 1 0
12 15 1 0
29 30 2 0
6 7 1 0
26 31 1 0
3 4 1 0
31 32 1 0
7 8 1 0
28 33 1 0
8 9 2 0
33 34 1 0
33 35 2 0
12 19 1 0
23 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.55Molecular Weight (Monoisotopic): 516.1479AlogP: 2.33#Rotatable Bonds: 6Polar Surface Area: 129.02Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.88CX Basic pKa: ┄CX LogP: 1.90CX LogD: 0.37Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -1.62
References 1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N.. (2006) Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents., 49 (15): [PMID:16854058 ] [10.1021/jm051296s ] 2. PubChem BioAssay data set,