(R)-5'-oxy-5'[(hydroxypyrophosphoroxy)phosphinyl]methyl]5'-propyl-adenosine

ID: ALA2092766

PubChem CID: 70695498

Max Phase: Preclinical

Molecular Formula: C13H22N5O13P3

Molecular Weight: 549.26

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C13H22N5O13P3/c1-2-3-13(4-28-33(24,25)31-34(26,27)30-32(21,22)23)9(20)8(19)12(29-13)18-6-17-7-10(14)15-5-16-11(7)18/h5-6,8-9,12,19-20H,2-4H2,1H3,(H,24,25)(H,26,27)(H2,14,15,16)(H2,21,22,23)/t8-,9+,12-,13-/m1/s1

Standard InChI Key:  VTGAZKVFAIUFMD-OTMMVIPVSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    8.3250   -2.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3250   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0625   -3.4500    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.6250   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6250   -1.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3250   -1.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2375   -3.6708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9125   -5.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1708   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7625   -2.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8125   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3000   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5750   -3.4500    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.5375   -3.4500    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   -5.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9708   -1.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9708   -2.7833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3125   -1.6458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1625   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0625   -4.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3125   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3375   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5750   -4.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5375   -4.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0625   -2.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3458   -5.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5750   -2.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5375   -2.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7750   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1458   -5.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9708   -0.5083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5833   -4.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7583   -4.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1708   -5.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3 11  1  0
  4  1  1  0
  5  4  2  0
  6 10  2  0
  7  2  1  0
  8  2  1  0
  9  7  1  0
 10  1  1  0
 11 13  1  0
 12  3  1  0
 13 22  1  0
 14 12  1  0
 15  8  1  0
 16  5  1  0
 17  4  1  0
 18 21  1  0
  9 19  1  1
 20  3  2  0
 21 17  2  0
 22 19  1  0
 23 13  2  0
 24 14  2  0
 25  3  1  0
  8 26  1  6
 27 13  1  0
 28 14  1  0
 29 14  1  0
 15 30  1  6
 31 16  1  0
  9 32  1  6
 33 32  1  0
 34 33  1  0
  5  6  1  0
  9 15  1  0
 16 18  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA2092766

   [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-propyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 549.26

Molecular Weight (Monoisotopic): 549.0427

AlogP: -0.46

#Rotatable Bonds: 10

Polar Surface Area: 279.13

Molecular Species: ACID

HBA: 14

HBD: 7

#RO5 Violations: 3

HBA (Lipinski): 18

HBD (Lipinski): 8

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 0.90

CX Basic pKa: 4.92

CX LogP: -4.11

CX LogD: -9.22

Aromatic Rings: 2

Heavy Atoms: 34

QED Weighted: 0.18

Np Likeness Score: 1.07

References

1. Kappler F, Hai TT, Cotter RJ, Hyver KJ, Hampton A..  (1986)  Isozyme-specific enzyme inhibitors. 11. L-homocysteine-ATP S-C5' covalent adducts as inhibitors of rat methionine adenosyltransferases.,  29  (6): [PMID:3486976] [10.1021/jm00156a022]

2. Kappler F, Hai TT, Cotter RJ, Hyver KJ, Hampton A..  (1986)  Isozyme-specific enzyme inhibitors. 11. L-homocysteine-ATP S-C5' covalent adducts as inhibitors of rat methionine adenosyltransferases.,  29  (6): [PMID:3486976] [10.1021/jm00156a022]

Source

Source(1):

• Scientific Literature