The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[3H]-4-(((R,E)-4-((R)-1-(7-ethoxy-7-oxoheptyl)-5-oxopyrrolidin-2-yl)-1,1-difluoro-1-phenylbut-3-en-2-yloxy)carbonylamino)-1-hydroxybutane-1,1-diphosphoric acid ID: ALA2092898
PubChem CID: 70691289
Max Phase: Preclinical
Molecular Formula: C28H42F2N2O12P2
Molecular Weight: 698.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: [3H]C([3H])([3H])COC(=O)CCCCCCN1C(=O)CC[C@@H]1/C=C/[C@@H](OC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C(F)(F)c1ccccc1
Standard InChI: InChI=1S/C28H42F2N2O12P2/c1-2-43-25(34)13-8-3-4-9-20-32-22(15-17-24(32)33)14-16-23(28(29,30)21-11-6-5-7-12-21)44-26(35)31-19-10-18-27(36,45(37,38)39)46(40,41)42/h5-7,11-12,14,16,22-23,36H,2-4,8-10,13,15,17-20H2,1H3,(H,31,35)(H2,37,38,39)(H2,40,41,42)/b16-14+/t22-,23+/m0/s1/i1T3
Standard InChI Key: BGRJEZNNRNOXJX-YITSXFCGSA-N
Molfile:
RDKit 2D
49 50 0 0 0 0 0 0 0 0999 V2000
11.8750 -6.1792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.2917 -6.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7040 -6.1767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4750 -6.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1895 -5.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6984 -5.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1840 -6.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6385 -7.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4340 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4789 -4.9924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1491 -7.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8629 -6.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5780 -7.3107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5794 -8.1357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0070 -7.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0069 -8.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7212 -8.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4360 -8.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4320 -7.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7171 -6.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1895 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9039 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6184 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3329 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0474 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7618 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4763 -4.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7618 -3.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1908 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9052 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8655 -8.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8669 -9.3743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1504 -8.1379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5820 -9.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2958 -9.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0109 -9.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0123 -10.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7274 -11.0197 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
12.2985 -11.0220 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.0042 -11.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7287 -11.8447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4412 -10.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4375 -11.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5833 -10.6107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2998 -11.8470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7083 -11.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6197 -4.4292 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.9052 -5.6667 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.6197 -5.2542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22 23 1 0
11 12 2 0
23 24 1 0
2 1 1 0
24 25 1 0
12 13 1 0
25 26 1 0
13 2 1 0
26 27 1 0
4 5 1 0
26 28 2 0
13 14 1 6
27 29 1 0
6 7 1 0
29 30 1 0
2 15 1 0
14 31 1 0
7 8 1 0
31 32 1 0
15 16 2 0
31 33 2 0
8 9 1 0
32 34 1 0
16 17 1 0
34 35 1 0
9 4 1 0
35 36 1 0
17 18 2 0
36 37 1 0
4 6 1 0
37 38 1 0
18 19 1 0
37 39 1 0
6 10 2 0
37 40 1 0
19 20 2 0
38 41 1 0
20 15 1 0
38 42 1 0
3 2 1 0
38 43 2 0
5 21 1 0
39 44 1 0
9 11 1 1
39 45 1 0
21 22 1 0
39 46 2 0
30 47 1 0
30 48 1 0
30 49 1 0
M ISO 3 47 3 48 3 49 3
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 698.59Molecular Weight (Monoisotopic): 698.2181AlogP: 3.72#Rotatable Bonds: 19Polar Surface Area: 220.23Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.70CX Basic pKa: ┄CX LogP: 2.01CX LogD: -2.92Aromatic Rings: 1Heavy Atoms: 46QED Weighted: 0.05Np Likeness Score: -0.02
References 1. Arns S, Gibe R, Moreau A, Monzur Morshed M, Young RN.. (2012) Design and synthesis of novel bone-targeting dual-action pro-drugs for the treatment and reversal of osteoporosis., 20 (6): [PMID:22341574 ] [10.1016/j.bmc.2012.01.024 ]