The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-Hexylsulfanyl-decanoic acid (6-methylsulfanyl-quinolin-5-yl)-amide ID: ALA2093029
PubChem CID: 70697535
Max Phase: Preclinical
Molecular Formula: C26H40N2OS2
Molecular Weight: 460.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC[C@@H](SCCCCCC)C(=O)Nc1c(SC)ccc2ncccc12
Standard InChI: InChI=1S/C26H40N2OS2/c1-4-6-8-10-11-12-16-24(31-20-13-9-7-5-2)26(29)28-25-21-15-14-19-27-22(21)17-18-23(25)30-3/h14-15,17-19,24H,4-13,16,20H2,1-3H3,(H,28,29)/t24-/m1/s1
Standard InChI Key: AIEKUIKBYWMJMS-XMMPIXPASA-N
Molfile:
RDKit 2D
31 32 0 0 1 0 0 0 0 0999 V2000
4.1837 -3.4321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4614 -3.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8976 -3.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4614 -2.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7474 -3.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7474 -1.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7432 -0.9562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8976 -2.1837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6158 -3.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 -3.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 -2.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7474 -4.2588 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.6158 -4.2505 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1711 -1.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4488 -0.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3298 -4.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3298 -3.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0334 -4.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1711 -0.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0438 -4.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0438 -3.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6262 -3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1982 -4.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4800 -4.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9122 -3.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4800 -3.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1940 -3.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7577 -3.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7661 -4.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3402 -3.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9122 -4.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 2 2 0
6 4 1 0
7 6 2 0
8 3 2 0
9 3 1 0
10 5 1 0
11 10 2 0
12 5 1 0
9 13 1 1
14 4 2 0
15 19 2 0
16 13 1 0
17 9 1 0
18 12 1 0
19 14 1 0
20 16 1 0
21 17 1 0
22 25 1 0
23 24 1 0
24 29 1 0
25 27 1 0
26 28 1 0
27 26 1 0
28 21 1 0
29 20 1 0
30 22 1 0
31 23 1 0
11 6 1 0
7 15 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.75Molecular Weight (Monoisotopic): 460.2582AlogP: 8.33#Rotatable Bonds: 16Polar Surface Area: 41.99Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.10CX Basic pKa: 4.32CX LogP: 8.48CX LogD: 8.48Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.20Np Likeness Score: -0.75
References 1. McCarthy PA, Hamanaka ES, Marzetta CA, Bamberger MJ, Gaynor BJ, Chang G, Kelly SE, Inskeep PB, Mayne JT, Beyer TA.. (1994) Potent, selective, and systemically-available inhibitors of acyl-coenzyme A:cholesterol acyl transferase (ACAT)., 37 (9): [PMID:8176701 ] [10.1021/jm00035a002 ]