The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{5-[(4,6-bis-phenylamino-[1,3,5]triazin-2-yl)-hydrazonomethyl]-furan-2-yl}-benzoic acid ID: ALA209327
PubChem CID: 9634974
Max Phase: Preclinical
Molecular Formula: C27H21N7O3
Molecular Weight: 491.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(-c2ccc(/C=N/Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)o2)cc1
Standard InChI: InChI=1S/C27H21N7O3/c35-24(36)19-13-11-18(12-14-19)23-16-15-22(37-23)17-28-34-27-32-25(29-20-7-3-1-4-8-20)31-26(33-27)30-21-9-5-2-6-10-21/h1-17H,(H,35,36)(H3,29,30,31,32,33,34)/b28-17+
Standard InChI Key: GZXSLWFHQYZQSY-OGLMXYFKSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.7075 0.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4946 -0.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9069 -0.9911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7224 -0.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1230 -0.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9020 0.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9769 -0.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3764 0.3914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4037 -1.0403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6688 -0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1861 0.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4000 0.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3997 -0.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1855 -0.9354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7324 -1.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9786 -0.8312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3108 -1.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6083 -0.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6337 -0.0604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9320 0.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2052 -0.0201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1843 -0.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8867 -1.2779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4598 -1.2438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7558 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9558 1.1967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6818 1.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7807 0.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0775 0.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3520 0.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3341 -0.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0380 -1.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3794 1.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1050 1.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1292 2.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4219 2.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6992 2.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
7 9 1 0
18 19 2 0
11 12 1 0
19 20 1 0
20 21 2 0
2 3 1 0
21 22 1 0
3 4 2 0
22 23 2 0
23 18 1 0
4 5 1 0
22 24 1 0
5 1 2 0
24 25 1 0
10 11 2 0
20 26 1 0
12 13 2 0
26 27 1 0
13 14 1 0
25 28 2 0
14 10 1 0
28 29 1 0
2 10 1 0
29 30 2 0
1 6 1 0
30 31 1 0
13 15 1 0
31 32 2 0
32 25 1 0
6 2 2 0
27 33 2 0
15 16 2 0
33 34 1 0
5 7 1 0
34 35 2 0
16 17 1 0
35 36 1 0
7 8 2 0
36 37 2 0
37 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.51Molecular Weight (Monoisotopic): 491.1706AlogP: 5.76#Rotatable Bonds: 9Polar Surface Area: 137.56Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.90CX Basic pKa: 3.28CX LogP: 6.41CX LogD: 3.65Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.15Np Likeness Score: -1.00
References 1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N.. (2006) Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents., 49 (15): [PMID:16854058 ] [10.1021/jm051296s ]