The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-Amino-5-hydroxy-6-methyl-tetrahydro-pyran-2-yloxy)-9-ethyl-6,9,11-trihydroxy-7,8,9,10-tetrahydro-naphthacene-5,12-dione hydrochloride ID: ALA2093884
PubChem CID: 70684983
Max Phase: Preclinical
Molecular Formula: C26H30ClNO8
Molecular Weight: 483.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](N)[C@@H](O)[C@H](C)O2)C1)C(=O)c1ccccc1C3=O.Cl
Standard InChI: InChI=1S/C26H29NO8.ClH/c1-3-26(33)9-14-18(16(10-26)35-17-8-15(27)21(28)11(2)34-17)25(32)20-19(24(14)31)22(29)12-6-4-5-7-13(12)23(20)30;/h4-7,11,15-17,21,28,31-33H,3,8-10,27H2,1-2H3;1H/t11-,15-,16-,17-,21-,26+;/m0./s1
Standard InChI Key: MUOZORTYCZNOHJ-XRPZNIJESA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-4.6172 3.2553 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-12.3400 4.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0545 5.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.7689 4.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.7690 3.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0545 3.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.3400 3.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6255 5.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9110 4.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9110 3.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6255 3.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1965 5.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4821 4.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4821 3.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1965 3.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7676 5.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0531 4.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0531 3.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7676 3.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6255 2.6019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.6255 5.9019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1965 2.6019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1965 5.9019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6406 5.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3386 4.2519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.7676 2.6019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.1842 2.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3977 1.2216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8144 0.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0175 0.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8040 1.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3873 2.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0279 -0.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4341 0.2684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.0071 1.8622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8156 5.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
11 7 1 0
7 2 2 0
2 8 1 0
8 9 1 0
10 11 1 0
9 12 1 0
10 9 2 0
15 10 1 0
12 13 2 0
14 15 2 0
19 14 1 0
14 13 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
11 20 2 0
8 21 2 0
15 22 1 0
12 23 1 0
17 24 1 0
17 25 1 1
19 26 1 6
27 26 1 1
27 28 1 0
32 27 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
29 33 1 6
30 34 1 1
31 35 1 6
24 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.1893AlogP: 1.84#Rotatable Bonds: 3Polar Surface Area: 159.54Molecular Species: BASEHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.24CX Basic pKa: 9.40CX LogP: 2.33CX LogD: 1.64Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: 1.64
References 1. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ.. (1990) Synthesis and antitumor activity of novel 4-demethoxyanthracyclines., 33 (9): [PMID:2391681 ] [10.1021/jm00171a010 ]