9-Acetyl-7-(4-amino-5-hydroxy-6-methyl-tetrahydro-pyran-2-yloxy)-6,9,11-trihydroxy-7,8,9,10-tetrahydro-naphthacene-5,12-dione hydrochloride

ID: ALA2094054

PubChem CID: 70689245

Max Phase: Preclinical

Molecular Formula: C26H28ClNO9

Molecular Weight: 497.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@@H](N)[C@H](O)[C@H](C)O2)C1)C(=O)c1ccccc1C3=O.Cl

Standard InChI:  InChI=1S/C26H27NO9.ClH/c1-10-21(29)15(27)7-17(35-10)36-16-9-26(34,11(2)28)8-14-18(16)25(33)20-19(24(14)32)22(30)12-5-3-4-6-13(12)23(20)31;/h3-6,10,15-17,21,29,32-34H,7-9,27H2,1-2H3;1H/t10-,15+,16-,17-,21+,26-;/m0./s1

Standard InChI Key:  JVHPTYWUBOQMBP-NGIBSTLRSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    4.7875   -0.5880    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3349    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3349   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0841   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0841    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3790    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3790   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5118    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7627   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7627    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7980   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7980    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5100   -2.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5095   -3.1755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5118   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2247   -1.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9384   -3.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9389   -2.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2237   -3.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7963   -1.9359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4960    0.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488    1.2064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0488   -1.6605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9265    1.2707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3808    1.2064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3805   -1.6605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0730   -0.2240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6147   -1.9107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7090   -3.5733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4766   -1.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4766    0.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0904   -4.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0695    1.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1905    0.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1905   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  2  5  1  0
  6  7  1  0
  2  8  1  0
  7  8  2  0
  3  9  1  0
  6  9  2  0
  4 11  1  0
  5 12  1  0
 11 12  1  0
  6 13  1  0
  7 14  1  0
 10 14  1  0
 15 16  1  0
 10 17  1  0
 13 17  1  0
 15 18  1  0
 18 20  1  0
 19 20  1  0
 16 21  1  0
 19 21  1  0
 13 22  1  6
 15 22  1  1
 10 23  1  0
  5 24  2  0
  4 25  2  0
 23 26  2  0
  8 27  1  0
  9 28  1  0
 10 29  1  6
 20 30  1  1
 19 31  1  6
 11 32  2  0
 12 33  2  0
 21 34  1  6
 23 35  1  0
 33 36  1  0
 32 37  1  0
 36 37  2  0
M  END

Associated Targets(non-human)

P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.50Molecular Weight (Monoisotopic): 497.1686AlogP: 1.02#Rotatable Bonds: 3
Polar Surface Area: 176.61Molecular Species: BASEHBA: 10HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.02CX Basic pKa: 9.18CX LogP: 1.51CX LogD: 1.06
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: 1.67

References

1. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ..  (1990)  Synthesis and antitumor activity of novel 4-demethoxyanthracyclines.,  33  (9): [PMID:2391681] [10.1021/jm00171a010]
2. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ..  (1990)  Synthesis and antitumor activity of 9-[(carbamoyloxy)alkyl]anthracyclines: a novel class of anthracycline derivatives.,  33  (9): [PMID:2391682] [10.1021/jm00171a011]

Source