4-{[3,3-Dimethyl-2-(3-methyl-2-methylamino-3-phenyl-butyrylamino)-butyryl]-methyl-amino}-2,5-dimethyl-hex-2-enoic acid

ID: ALA2096805

PubChem CID: 11454292

Max Phase: Preclinical

Molecular Formula: C27H43N3O4

Molecular Weight: 473.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@H](C(=O)N[C@@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1

Standard InChI:  InChI=1S/C27H43N3O4/c1-17(2)20(16-18(3)25(33)34)30(10)24(32)22(26(4,5)6)29-23(31)21(28-9)27(7,8)19-14-12-11-13-15-19/h11-17,20-22,28H,1-10H3,(H,29,31)(H,33,34)/b18-16+/t20-,21-,22+/m1/s1

Standard InChI Key:  CNTMOLDWXSVYKD-TYOFZRJGSA-N

Molfile:  

     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
    0.9375   -0.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542    0.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2000    0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0875    0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4833   -0.1250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2292    0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -0.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000   -0.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6333    0.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9125   -0.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5167    0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2250    1.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9375   -0.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083    1.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3458   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5125    1.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9125   -0.9500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3750   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292   -0.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542    1.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458    0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2208    0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0167    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9375    1.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4958    1.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3458   -0.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0625    0.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6250   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0917   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7708   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0625   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7708   -0.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  7  1  0
  5  6  1  0
  6  1  1  0
  7  2  1  0
  8  4  2  0
  9 10  1  0
 10  3  1  0
 11  8  1  0
  6 12  1  6
 13  1  2  0
 14  3  2  0
 15  9  1  0
 16 11  2  0
 10 17  1  1
  7 18  1  6
 19 11  1  0
 20  2  1  0
 21  9  1  0
 22  9  1  0
 23  8  1  0
 24 12  1  0
 25 12  1  0
 26 12  1  0
 27 15  1  0
 28 15  2  0
 29 17  1  0
 30 18  1  0
 31 18  1  0
 32 28  1  0
 33 27  2  0
 34 32  2  0
 33 34  1  0
M  END

Associated Targets(Human)

TUBB1 Tclin Tubulin beta-1 chain (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.66Molecular Weight (Monoisotopic): 473.3254AlogP: 3.60#Rotatable Bonds: 10
Polar Surface Area: 98.74Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.21CX Basic pKa: 8.41CX LogP: 2.01CX LogD: 1.98
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: 1.50

References

1. Zask A, Birnberg G, Cheung K, Kaplan J, Niu C, Norton E, Suayan R, Yamashita A, Cole D, Tang Z, Krishnamurthy G, Williamson R, Khafizova G, Musto S, Hernandez R, Annable T, Yang X, Discafani C, Beyer C, Greenberger LM, Loganzo F, Ayral-Kaloustian S..  (2004)  Synthesis and biological activity of analogues of the antimicrotubule agent N,beta,beta-trimethyl-L-phenylalanyl-N(1)-[(1S,2E)-3-carboxy-1-isopropylbut-2-enyl]- N(1),3-dimethyl-L-valinamide (HTI-286).,  47  (19): [PMID:15341492] [10.1021/jm040056u]

Source