The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{[3,3-Dimethyl-2-(3-methyl-2-methylamino-3-phenyl-butyrylamino)-butyryl]-methyl-amino}-2,5-dimethyl-hex-2-enoic acid ID: ALA2096805
PubChem CID: 11454292
Max Phase: Preclinical
Molecular Formula: C27H43N3O4
Molecular Weight: 473.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@H](C(=O)N[C@@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1
Standard InChI: InChI=1S/C27H43N3O4/c1-17(2)20(16-18(3)25(33)34)30(10)24(32)22(26(4,5)6)29-23(31)21(28-9)27(7,8)19-14-12-11-13-15-19/h11-17,20-22,28H,1-10H3,(H,29,31)(H,33,34)/b18-16+/t20-,21-,22+/m1/s1
Standard InChI Key: CNTMOLDWXSVYKD-TYOFZRJGSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
0.9375 -0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 0.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2000 0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0875 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4833 -0.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2292 0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3667 -0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8000 -0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6333 0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9125 -0.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5167 0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2250 1.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9375 -0.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2083 1.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3458 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5125 1.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9125 -0.9500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3750 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -0.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0458 0.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2208 0.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0167 0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9375 1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4958 1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3458 -0.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0625 0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6250 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0917 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6542 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7708 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0625 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7708 -0.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 7 1 0
5 6 1 0
6 1 1 0
7 2 1 0
8 4 2 0
9 10 1 0
10 3 1 0
11 8 1 0
6 12 1 6
13 1 2 0
14 3 2 0
15 9 1 0
16 11 2 0
10 17 1 1
7 18 1 6
19 11 1 0
20 2 1 0
21 9 1 0
22 9 1 0
23 8 1 0
24 12 1 0
25 12 1 0
26 12 1 0
27 15 1 0
28 15 2 0
29 17 1 0
30 18 1 0
31 18 1 0
32 28 1 0
33 27 2 0
34 32 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.66Molecular Weight (Monoisotopic): 473.3254AlogP: 3.60#Rotatable Bonds: 10Polar Surface Area: 98.74Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.21CX Basic pKa: 8.41CX LogP: 2.01CX LogD: 1.98Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: 1.50
References 1. Zask A, Birnberg G, Cheung K, Kaplan J, Niu C, Norton E, Suayan R, Yamashita A, Cole D, Tang Z, Krishnamurthy G, Williamson R, Khafizova G, Musto S, Hernandez R, Annable T, Yang X, Discafani C, Beyer C, Greenberger LM, Loganzo F, Ayral-Kaloustian S.. (2004) Synthesis and biological activity of analogues of the antimicrotubule agent N,beta,beta-trimethyl-L-phenylalanyl-N(1)-[(1S,2E)-3-carboxy-1-isopropylbut-2-enyl]- N(1),3-dimethyl-L-valinamide (HTI-286)., 47 (19): [PMID:15341492 ] [10.1021/jm040056u ]