The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(4-chloro-4'-cyanobiphenyl-2-ylmethoxy)phenyl]-1-cyclohexyl-1H-benzimidazole-5-carboxylic acid ID: ALA209681
PubChem CID: 11847470
Max Phase: Preclinical
Molecular Formula: C34H28ClN3O3
Molecular Weight: 562.07
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(-c2ccc(Cl)cc2COc2ccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCCC3)cc2)cc1
Standard InChI: InChI=1S/C34H28ClN3O3/c35-27-13-16-30(23-8-6-22(20-36)7-9-23)26(18-27)21-41-29-14-10-24(11-15-29)33-37-31-19-25(34(39)40)12-17-32(31)38(33)28-4-2-1-3-5-28/h6-19,28H,1-5,21H2,(H,39,40)
Standard InChI Key: FQUMRIWAJBYZSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
7.6612 -17.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6601 -18.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3744 -19.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3728 -17.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0876 -17.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0923 -18.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8838 -18.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3683 -18.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8762 -17.6173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1431 -19.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5929 -20.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8493 -21.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6567 -21.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2074 -20.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9507 -19.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1933 -18.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6054 -18.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4296 -18.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8389 -18.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4178 -17.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5950 -17.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6638 -18.2666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0813 -18.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9063 -18.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3201 -19.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1443 -19.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5526 -18.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1307 -18.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3077 -18.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8873 -17.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2960 -16.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8762 -16.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0503 -16.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6461 -16.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0683 -17.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9442 -17.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9439 -16.6457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2298 -17.8835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5614 -20.3926 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.6257 -15.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2042 -14.7151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
21 16 1 0
7 10 1 0
19 22 1 0
10 11 1 0
22 23 1 0
5 6 1 0
23 24 1 0
24 25 2 0
2 3 1 0
25 26 1 0
3 6 2 0
26 27 2 0
1 2 2 0
27 28 1 0
10 15 1 0
28 29 2 0
29 24 1 0
11 12 1 0
29 30 1 0
12 13 1 0
30 31 2 0
13 14 1 0
31 32 1 0
14 15 1 0
32 33 2 0
5 4 2 0
33 34 1 0
8 16 1 0
34 35 2 0
35 30 1 0
6 7 1 0
16 17 2 0
7 8 1 0
36 37 2 0
36 38 1 0
1 36 1 0
17 18 1 0
26 39 1 0
8 9 2 0
18 19 2 0
40 41 3 0
33 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.07Molecular Weight (Monoisotopic): 561.1819AlogP: 8.68#Rotatable Bonds: 7Polar Surface Area: 88.14Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.14CX Basic pKa: 5.08CX LogP: 7.34CX LogD: 5.38Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -1.10
References 1. Hirashima S, Suzuki T, Ishida T, Noji S, Yata S, Ando I, Komatsu M, Ikeda S, Hashimoto H.. (2006) Benzimidazole derivatives bearing substituted biphenyls as hepatitis C virus NS5B RNA-dependent RNA polymerase inhibitors: structure-activity relationship studies and identification of a potent and highly selective inhibitor JTK-109., 49 (15): [PMID:16854079 ] [10.1021/jm060269e ] 2. Mahmoud AH, Elsayed MSA, ElHefnawi M. (2013) Structure-based predictive model for some benzimidazole inhibitors of hepatitis C virus NS5B polymerase, 22 (4): [10.1007/s00044-012-0186-8 ]