The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[5-(4-Hydrazonomethyl-phenoxy)-pentyloxy]-N,N-diisopropyl-3-methoxy-benzamide; compound with (Z)-but-2-enedioic acid ID: ALA2104429
Cas Number: 147398-01-4
PubChem CID: 9959759
Max Phase: Unknown
Molecular Formula: C30H41N3O8
Molecular Weight: 455.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Moxilubant maleate | CGS 25019C | CGS-25019C | Moxilubant maleate|CGS 25019C|Moxilubant maleate [USAN]|Cgs-25019C|147398-01-4|LTB 019|PDY6PVU0RB|Moxilubant maleate (USAN)|4-((5-(p-Amidinophenoxy)pentyl)oxy)-N,N-diisopropyl-3-methoxybenzamide maleate (1:1)|(Z)-but-2-enedioic acid;4-[5-(4-carbamimidoylphenoxy)pentoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide|UNII-PDY6PVU0RB|cgs25019c|SCHEMBL1231167|CHEMBL2104429|D05085|Q27286497
Canonical SMILES: COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCCOc1ccc(C(=N)N)cc1.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C26H37N3O4.C4H4O4/c1-18(2)29(19(3)4)26(30)21-11-14-23(24(17-21)31-5)33-16-8-6-7-15-32-22-12-9-20(10-13-22)25(27)28;5-3(6)1-2-4(7)8/h9-14,17-19H,6-8,15-16H2,1-5H3,(H3,27,28);1-2H,(H,5,6)(H,7,8)/b;2-1-
Standard InChI Key: BUMMZWFWCNQFPS-BTJKTKAUSA-N
Molfile:
RDKit 2D
41 41 0 0 0 0 0 0 0 0999 V2000
0.5224 -3.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5224 -3.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1594 -2.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7686 -3.1388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1594 -2.0531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1456 -4.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7549 -3.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1456 -4.9365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8005 -0.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1900 -0.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4174 -0.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8005 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5801 -0.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0480 -0.0820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4174 -1.1461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1665 0.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5801 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9633 -0.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0480 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6483 -0.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9391 1.0130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 -0.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4277 0.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6544 0.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6483 -1.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2651 -0.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3189 0.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7020 1.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0714 0.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5013 1.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1829 0.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7694 1.0130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3621 0.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9927 1.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3621 -0.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6060 0.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9927 -0.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6060 -0.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2401 -0.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8297 -0.0483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2401 -1.0751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 6 1 0
2 3 1 0
3 4 1 0
3 5 2 0
6 7 1 0
6 8 2 0
39 40 1 0
39 41 2 0
16 17 1 0
37 38 1 0
9 10 2 0
9 11 1 0
9 12 1 0
10 13 1 0
11 14 1 0
11 15 2 0
12 16 2 0
13 17 2 0
13 18 1 0
14 19 1 0
14 20 1 0
17 21 1 0
18 22 1 0
19 23 1 0
19 24 1 0
20 25 1 0
20 26 1 0
21 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
33 35 1 0
34 36 1 0
35 37 2 0
36 38 2 0
38 39 1 0
M END
Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: YesAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.60Molecular Weight (Monoisotopic): 455.2784AlogP: 4.87#Rotatable Bonds: 13Polar Surface Area: 97.87Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 11.83CX LogP: 4.09CX LogD: 1.68Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -0.54
References 1. Cohen N, Bizzarro FT, May WP, Toth K, Lee FK, Heslin PH, Holland GW, Kwoh SC, Franco LS, Simko BA, Yagaloff KA. (1994) Benzenepropanoic acids containing chromanone or naphthalenone moieties are potent and orally active leukotriene B4 antagonists, 4 (24): [10.1016/S0960-894X(01)80833-7 ] 2. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date,