The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(2-(cyclohexyloxy)-6-methylpyrimidin-4-yl)thiazol-2-yl)-5-((4-methylpiperazin-1-yl)methyl)pyrazin-2-amine ID: ALA210540
Cas Number: 874473-15-1
PubChem CID: 16037675
Max Phase: Preclinical
Molecular Formula: C24H32N8OS
Molecular Weight: 480.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2cnc(Nc3cnc(CN4CCN(C)CC4)cn3)s2)nc(OC2CCCCC2)n1
Standard InChI: InChI=1S/C24H32N8OS/c1-17-12-20(29-23(28-17)33-19-6-4-3-5-7-19)21-14-27-24(34-21)30-22-15-25-18(13-26-22)16-32-10-8-31(2)9-11-32/h12-15,19H,3-11,16H2,1-2H3,(H,26,27,30)
Standard InChI Key: DLIDUXYWQPLFEM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-3.4086 -9.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5837 -9.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8314 -8.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1623 -9.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3382 -9.8106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9352 -9.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3625 -8.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1852 -8.3940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5688 -7.6336 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.2286 -7.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9035 -7.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6607 -8.4012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2157 -6.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4952 -5.9153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4819 -5.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1904 -4.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9136 -5.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9233 -5.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7609 -4.6902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0532 -5.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0690 -5.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3653 -6.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6420 -5.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6267 -5.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3348 -4.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6230 -4.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1103 -9.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3135 -9.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0898 -10.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3304 -11.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1558 -11.1983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5592 -10.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1372 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5769 -11.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 2 2 0
16 17 1 0
3 9 1 0
17 18 2 0
18 13 1 0
15 19 1 0
4 5 2 0
19 20 1 0
20 21 1 0
1 3 1 0
5 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
12 3 2 0
17 26 1 0
1 2 1 0
6 27 1 0
10 13 1 0
27 28 1 0
28 29 1 0
6 7 2 0
13 14 2 0
2 4 1 0
14 15 1 0
7 8 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
15 16 2 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.64Molecular Weight (Monoisotopic): 480.2420AlogP: 3.90#Rotatable Bonds: 7Polar Surface Area: 92.19Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.14CX Basic pKa: 7.35CX LogP: 2.96CX LogD: 2.93Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.29
References 1. Shimamura T, Shibata J, Kurihara H, Mita T, Otsuki S, Sagara T, Hirai H, Iwasawa Y.. (2006) Identification of potent 5-pyrimidinyl-2-aminothiazole CDK4, 6 inhibitors with significant selectivity over CDK1, 2, 5, 7, and 9., 16 (14): [PMID:16682184 ] [10.1016/j.bmcl.2006.04.048 ]