The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-((R)-1-Benzyl-pyrrolidin-3-yl)-ethyl]-[2-(5-bromo-2-methoxy-phenyl)-oxazol-4-ylmethyl]-amine ID: ALA2111527
PubChem CID: 71457956
Max Phase: Preclinical
Molecular Formula: C24H28BrN3O2
Molecular Weight: 470.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Br)cc1-c1nc(CNCCC2CCN(Cc3ccccc3)C2)co1
Standard InChI: InChI=1S/C24H28BrN3O2/c1-29-23-8-7-20(25)13-22(23)24-27-21(17-30-24)14-26-11-9-19-10-12-28(16-19)15-18-5-3-2-4-6-18/h2-8,13,17,19,26H,9-12,14-16H2,1H3
Standard InChI Key: PUTIADDALKYHRM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.3199 -1.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0854 -1.5268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6002 -1.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3698 -0.4036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6096 -0.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1235 -2.8249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1603 -0.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6002 -2.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8846 -1.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8224 -3.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3621 -3.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8846 -2.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0777 -2.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1732 -1.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1732 -2.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8078 -1.6641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4535 -1.2148 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.4333 -0.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3199 -2.8831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5505 -2.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2790 -1.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8379 -2.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6315 -1.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0059 -2.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2452 -3.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5879 -2.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3199 -3.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3201 -1.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9733 -2.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0190 -2.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 1 1 0
5 2 1 0
6 11 1 0
7 4 1 0
8 3 1 0
9 3 2 0
10 6 1 0
11 22 1 0
12 8 2 0
13 21 1 0
14 9 1 0
15 14 2 0
16 18 1 0
17 14 1 0
18 5 1 0
19 8 1 0
20 10 1 0
21 22 1 0
22 24 1 0
23 16 1 0
24 23 1 0
25 20 2 0
26 20 1 0
27 19 1 0
28 26 2 0
29 25 1 0
30 28 1 0
5 7 2 0
15 12 1 0
13 6 1 0
30 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.41Molecular Weight (Monoisotopic): 469.1365AlogP: 5.11#Rotatable Bonds: 9Polar Surface Area: 50.53Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.73CX LogP: 4.40CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -1.37
References 1. Einsiedel J, Thomas C, Hübner H, Gmeiner P.. (2000) Phenyloxazoles and phenylthiazoles as benzamide bioisosteres: synthesis and dopamine receptor binding profiles., 10 (17): [PMID:10987445 ] [10.1016/s0960-894x(00)00405-4 ]