5-[3-(Bicyclo[2.2.1]hept-2-yloxy)-4-methoxy-phenyl]-1-methyl-imidazolidin-2-one

ID: ALA2111611

PubChem CID: 71459872

Max Phase: Preclinical

Molecular Formula: C18H24N2O3

Molecular Weight: 316.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C2CNC(=O)N2C)cc1O[C@H]1CC2CCC1C2

Standard InChI:  InChI=1S/C18H24N2O3/c1-20-14(10-19-18(20)21)12-5-6-15(22-2)17(9-12)23-16-8-11-3-4-13(16)7-11/h5-6,9,11,13-14,16H,3-4,7-8,10H2,1-2H3,(H,19,21)/t11?,13?,14?,16-/m0/s1

Standard InChI Key:  GCEUBBGDHJJDSY-LUSXFMQSSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
    8.9262   -4.5238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6662   -5.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -4.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8343   -5.3096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -3.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5281   -1.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8001   -1.5311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0837   -1.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5801   -4.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5281   -2.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3962   -1.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1574   -5.9855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -1.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0029   -1.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7376   -0.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -2.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2517   -1.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -1.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9282   -2.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7120   -4.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8531   -1.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -0.6991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9609   -0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6 10  2  0
  7  6  1  0
  8  7  1  6
  9  3  1  0
 10  5  1  0
 11  8  1  0
 12  2  2  0
 13 18  2  0
 14  8  1  0
 15 11  1  0
 16  5  2  0
 17 14  1  0
 18 16  1  0
 19 11  1  0
 20  1  1  0
 21 17  1  0
 22 13  1  0
 23 22  1  0
  4  9  1  0
  6 13  1  0
 15 17  1  0
 21 19  1  0
M  END

Associated Targets(non-human)

Pde4d Phosphodiesterase 4 (578 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.40Molecular Weight (Monoisotopic): 316.1787AlogP: 2.96#Rotatable Bonds: 4
Polar Surface Area: 50.80Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.67CX Basic pKa: CX LogP: 2.15CX LogD: 2.15
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.93Np Likeness Score: 0.43

References

1. Saccomano NA, Vinick FJ, Koe BK, Nielsen JA, Whalen WM, Meltz M, Phillips D, Thadieo PF, Jung S, Chapin DS..  (1991)  Calcium-independent phosphodiesterase inhibitors as putative antidepressants: [3-(bicycloalkyloxy)-4-methoxyphenyl]-2-imidazolidinones.,  34  (1): [PMID:1992129] [10.1021/jm00105a045]

Source