3-(1-Aminooxalyl-3-biphenyl-2-ylmethyl-2-ethyl-indolizin-8-yloxy)-propionic acid

ID: ALA2111798

PubChem CID: 10576315

Max Phase: Preclinical

Molecular Formula: C28H26N2O5

Molecular Weight: 470.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1c(C(=O)C(N)=O)c2cc(OCCC(=O)O)ccn2c1Cc1ccccc1-c1ccccc1

Standard InChI:  InChI=1S/C28H26N2O5/c1-2-21-23(16-19-10-6-7-11-22(19)18-8-4-3-5-9-18)30-14-12-20(35-15-13-25(31)32)17-24(30)26(21)27(33)28(29)34/h3-12,14,17H,2,13,15-16H2,1H3,(H2,29,34)(H,31,32)

Standard InChI Key:  NHAAMMHRYGBJBY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.9844   -9.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1946  -10.4558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1946   -9.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9844  -10.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4823  -10.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2419   -8.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7726  -11.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5151   -9.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0489   -8.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3449  -12.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5151  -10.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0988  -12.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2304  -10.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2304   -9.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6925   -7.9721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5983   -9.0194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2919  -13.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3006   -7.6230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3064  -10.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1519  -11.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6540  -13.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0515  -13.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2689  -12.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7185  -10.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7013  -12.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4609  -13.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7497  -14.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0645  -12.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3162  -13.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9471   -9.2231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6616   -9.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3760   -9.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0905   -9.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8050   -9.2231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0905  -10.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  2  0
  4  5  2  0
  5  1  1  0
  6  1  1  0
  7  4  1  0
  8  3  1  0
  9  6  1  0
 10  7  1  0
 11  2  1  0
 12 10  2  0
 13 14  1  0
 14  8  2  0
 15  6  2  0
 16  9  2  0
 17 12  1  0
 18  9  1  0
 19  5  1  0
 20 10  1  0
 21 12  1  0
 22 17  1  0
 23 17  2  0
 24 19  1  0
 25 20  2  0
 26 25  1  0
 27 22  2  0
 28 23  1  0
 29 28  2  0
  2  4  1  0
 11 13  2  0
 21 26  2  0
 29 27  1  0
 14 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Associated Targets(Human)

PLA2G1B Tchem Phospholipase A2 group 1B (720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.1842AlogP: 4.28#Rotatable Bonds: 10
Polar Surface Area: 111.10Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.62CX Basic pKa: CX LogP: 4.34CX LogD: 1.00
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.29

References

1. Hagishita S, Yamada M, Shirahase K, Okada T, Murakami Y, Ito Y, Matsuura T, Wada M, Kato T, Ueno M, Chikazawa Y, Yamada K, Ono T, Teshirogi I, Ohtani M..  (1996)  Potent inhibitors of secretory phospholipase A2: synthesis and inhibitory activities of indolizine and indene derivatives.,  39  (19): [PMID:8809154] [10.1021/jm960395q]

Source