4-(1-Aminooxalyl-3-biphenyl-2-ylmethyl-2-ethyl-indolizin-8-yloxy)-butyric acid

ID: ALA2111800

PubChem CID: 10672505

Max Phase: Preclinical

Molecular Formula: C29H28N2O5

Molecular Weight: 484.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCc1c(C(=O)C(N)=O)c2cc(OCCCC(=O)O)ccn2c1Cc1ccccc1-c1ccccc1

Standard InChI:  InChI=1S/C29H28N2O5/c1-2-22-24(17-20-11-6-7-12-23(20)19-9-4-3-5-10-19)31-15-14-21(36-16-8-13-26(32)33)18-25(31)27(22)28(34)29(30)35/h3-7,9-12,14-15,18H,2,8,13,16-17H2,1H3,(H2,30,35)(H,32,33)

Standard InChI Key:  AGTBOLQFGOUEPD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    4.7615   -7.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9718   -8.6589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9718   -7.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7615   -8.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2594   -8.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0191   -6.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0191   -9.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2621   -7.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8260   -6.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4697  -10.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2621   -9.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7272  -11.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5468   -8.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5468   -7.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4697   -6.1694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3754   -7.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5341  -11.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0778   -5.8260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0836   -8.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6627  -10.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1778  -11.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7917  -12.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0836  -10.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7875   -8.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1133  -10.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3709  -11.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8847  -10.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5986  -12.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1480  -11.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8325   -7.4162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1180   -7.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4036   -7.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3109   -7.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0254   -7.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7399   -7.8287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0254   -6.5912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  2  0
  4  5  2  0
  5  1  1  0
  6  1  1  0
  7  4  1  0
  8  3  1  0
  9  6  1  0
 10  7  1  0
 11  2  1  0
 12 10  1  0
 13 14  1  0
 14  8  2  0
 15  6  2  0
 16  9  2  0
 17 12  1  0
 18  9  1  0
 19  5  1  0
 20 10  2  0
 21 12  2  0
 22 17  2  0
 23 17  1  0
 24 19  1  0
 25 20  1  0
 26 25  2  0
 27 23  2  0
 28 22  1  0
 29 27  1  0
  2  4  1  0
 11 13  2  0
 21 26  1  0
 28 29  2  0
 14 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA2111800

   4-[2-Ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-7-yl]oxybutanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 484.55

Molecular Weight (Monoisotopic): 484.1998

AlogP: 4.67

#Rotatable Bonds: 11

Polar Surface Area: 111.10

Molecular Species: ACID

HBA: 5

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 3.91

CX Basic pKa: ┄

CX LogP: 4.63

CX LogD: 1.42

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.18

Np Likeness Score: -0.24

References

1. Hagishita S, Yamada M, Shirahase K, Okada T, Murakami Y, Ito Y, Matsuura T, Wada M, Kato T, Ueno M, Chikazawa Y, Yamada K, Ono T, Teshirogi I, Ohtani M..  (1996)  Potent inhibitors of secretory phospholipase A2: synthesis and inhibitory activities of indolizine and indene derivatives.,  39  (19): [PMID:8809154] [10.1021/jm960395q]

Source

Source(1):

• Scientific Literature