5-[4-Methoxy-3-(octahydro-4,7-methano-inden-5-yloxy)-phenyl]-1-methyl-imidazolidin-2-one

ID: ALA2112409

PubChem CID: 71458007

Max Phase: Preclinical

Molecular Formula: C21H28N2O3

Molecular Weight: 356.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C2CNC(=O)N2C)cc1O[C@@H]1CC2CC1C1CCCC21

Standard InChI:  InChI=1S/C21H28N2O3/c1-23-17(11-22-21(23)24)12-6-7-18(25-2)20(9-12)26-19-10-13-8-16(19)15-5-3-4-14(13)15/h6-7,9,13-17,19H,3-5,8,10-11H2,1-2H3,(H,22,24)/t13?,14?,15?,16?,17?,19-/m1/s1

Standard InChI Key:  FHWOSRUUSHMKKA-IJNOCJQWSA-N

Molfile:  

     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
    8.9262   -4.5238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6662   -5.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4077   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0837   -1.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1709   -1.2711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -4.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8343   -5.3096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0091   -2.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5989   -0.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8531   -1.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5281   -1.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -3.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8001   -1.5311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9277   -1.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5801   -4.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5281   -2.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1574   -5.9855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -1.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -2.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -1.9471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7120   -4.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8184   -3.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2387   -0.6991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2869   -2.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4256   -3.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9609   -0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4 13  1  1
  5 14  1  0
  6  1  1  0
  7  2  1  0
  8  3  1  0
  9  3  1  0
 10  5  1  0
 11 16  2  0
 12  6  1  0
 13 11  1  0
 14  4  1  0
 15  6  1  0
 16 12  1  0
 17  2  2  0
 18 20  2  0
 19 12  2  0
 20 19  1  0
 21  1  1  0
 22  8  1  0
 23 18  1  0
 24 10  1  0
 25 22  1  0
 26 23  1  0
  7 15  1  0
 11 18  1  0
  9  5  1  0
  8 10  1  0
 25 24  1  0
M  END

Associated Targets(non-human)

Pde4d Phosphodiesterase 4 (578 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.47Molecular Weight (Monoisotopic): 356.2100AlogP: 3.59#Rotatable Bonds: 4
Polar Surface Area: 50.80Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: CX LogP: 2.70CX LogD: 2.70
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.90Np Likeness Score: 0.80

References

1. Saccomano NA, Vinick FJ, Koe BK, Nielsen JA, Whalen WM, Meltz M, Phillips D, Thadieo PF, Jung S, Chapin DS..  (1991)  Calcium-independent phosphodiesterase inhibitors as putative antidepressants: [3-(bicycloalkyloxy)-4-methoxyphenyl]-2-imidazolidinones.,  34  (1): [PMID:1992129] [10.1021/jm00105a045]

Source