The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium salt 4-hydroxy-2-(3,4,5-trihydroxy-6-methoxy-tetrahydro-pyran-2-ylmethylsulfanyl)-butyrate ID: ALA2112527
PubChem CID: 71461627
Max Phase: Preclinical
Molecular Formula: C11H19NaO8S
Molecular Weight: 312.34
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1O[C@@H](CSC(CCO)C(=O)[O-])[C@H](O)[C@H](O)[C@@H]1O.[Na+]
Standard InChI: InChI=1S/C11H20O8S.Na/c1-18-11-9(15)8(14)7(13)5(19-11)4-20-6(2-3-12)10(16)17;/h5-9,11-15H,2-4H2,1H3,(H,16,17);/q;+1/p-1/t5-,6?,7-,8-,9-,11+;/m0./s1
Standard InChI Key: KEJIMGYZTGIXHF-WERAIWOBSA-M
Molfile:
RDKit 2D
21 20 0 0 0 0 0 0 0 0999 V2000
10.9612 -2.5330 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
9.2833 -4.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7146 -5.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5340 -3.8445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2218 -5.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1360 -4.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0875 -4.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7368 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2546 -3.1823 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7018 -3.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3990 -2.4173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0682 -2.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7240 -1.2729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4761 -5.3103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9496 -5.2524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1360 -3.3430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0897 -4.5516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4060 -2.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7888 -0.5207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3932 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0540 -5.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 5 1 0
5 2 1 0
6 3 1 0
7 4 1 0
8 12 1 0
9 10 1 0
7 10 1 1
11 8 1 0
12 9 1 0
13 8 2 0
2 14 1 6
3 15 1 1
6 16 1 1
5 17 1 1
18 12 1 0
19 20 1 0
20 18 1 0
21 17 1 0
6 7 1 0
M CHG 2 1 1 11 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 312.34Molecular Weight (Monoisotopic): 312.0879AlogP: -1.99#Rotatable Bonds: 7Polar Surface Area: 136.68Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.87CX Basic pKa: ┄CX LogP: -2.06CX LogD: -5.29Aromatic Rings: ┄Heavy Atoms: 20QED Weighted: 0.36Np Likeness Score: 1.49
References 1. Fazli A, Bradley SJ, Kiefel MJ, Jolly C, Holmes IH, von Itzstein M.. (2001) Synthesis and biological evaluation of sialylmimetics as rotavirus inhibitors., 44 (20): [PMID:11563928 ] [10.1021/jm0100887 ]