17-(cyclopropylmethyl)-6beta-(2-naphthylmethoxy)-4,5alpha-epoxy-3,14-dihydroxymorphinan

ID: ALA2112729

PubChem CID: 71456225

Max Phase: Preclinical

Molecular Formula: C31H33NO4

Molecular Weight: 483.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1ccc2c3c1OC1[C@H](OCc4ccc5ccccc5c4)CCC4(O)C(C2)N(CC2CC2)CCC314

Standard InChI:  InChI=1S/C31H33NO4/c33-24-10-9-23-16-26-31(34)12-11-25(35-18-20-7-8-21-3-1-2-4-22(21)15-20)29-30(31,27(23)28(24)36-29)13-14-32(26)17-19-5-6-19/h1-4,7-10,15,19,25-26,29,33-34H,5-6,11-14,16-18H2/t25-,26?,29?,30?,31?/m1/s1

Standard InChI Key:  ZSXCQUHBSATCCZ-JWDZAJNQSA-N

Molfile:  

     RDKit          2D

 36 43  0  0  0  0  0  0  0  0999 V2000
    6.5301   -4.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8224   -3.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5301   -5.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3068   -4.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2550   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7901   -4.6833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1148   -4.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3899   -4.0964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8224   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1148   -5.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6958   -4.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6451   -3.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6764   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1640   -3.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2550   -6.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9767   -4.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6649   -2.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0792   -2.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2507   -2.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8224   -6.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3457   -4.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8717   -3.2507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5981   -3.0781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3586   -3.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9314   -3.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5301   -6.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9314   -5.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1029   -5.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1144   -3.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7002   -3.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7002   -4.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9742   -6.7545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1684   -4.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3571   -6.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5884   -5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1742   -6.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  4  1  0
  7  2  1  0
  8 16  1  0
  9  3  1  0
 10  9  1  0
 11  1  1  0
 12  2  1  0
 13  8  1  0
 14  4  1  0
 15  5  1  0
 16 11  1  0
 17 13  1  0
 18 17  1  0
 19 17  1  0
 20  9  2  0
 21 25  2  0
 14 22  1  1
 23  2  1  0
 24 14  1  0
 25 29  1  0
 26 20  1  0
 27 28  2  0
 28 31  1  0
 29 30  1  0
 30 22  1  0
 31 29  2  0
 32 15  1  0
 33 21  1  0
 34 27  1  0
 35 33  2  0
 36 34  2  0
  5  6  1  0
  8  7  1  0
 24 12  1  0
 10  7  1  0
 15 26  2  0
 18 19  1  0
 27 21  1  0
 36 35  1  0
M  END

Associated Targets(Human)

OPRK1 Tclin Opioid receptors; mu/kappa/delta (568 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRD1 Tclin Delta opioid receptor (15096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

OPRM1 Mu opioid receptor (3620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRK1 Kappa opioid receptor (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.61Molecular Weight (Monoisotopic): 483.2410AlogP: 4.69#Rotatable Bonds: 5
Polar Surface Area: 62.16Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.30CX Basic pKa: 9.47CX LogP: 4.20CX LogD: 2.41
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: 1.18

References

1. Nelson TD, Davis RD, Nelson WL..  (1994)  Synthesis and opioid receptor affinity of a series of aralkyl ethers of 6 alpha- and 6 beta-naltrexol.,  37  (25): [PMID:7996538] [10.1021/jm00051a003]

Source