11-[4-(2-Piperidin-1-yl-ethoxy)-phenyl]-6,11-dihydro-5H-benzo[a]fluorene-3,9-diol

ID: ALA2112950

Cas Number: 138630-67-8

PubChem CID: 15129667

Max Phase: Preclinical

Molecular Formula: C30H29NO3

Molecular Weight: 451.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1ccc2c(c1)C(c1ccc(OCCN3CCCCC3)cc1)c1c-2ccc2cc(O)ccc12

Standard InChI:  InChI=1S/C30H29NO3/c32-22-7-12-25-21(18-22)6-11-27-26-13-8-23(33)19-28(26)29(30(25)27)20-4-9-24(10-5-20)34-17-16-31-14-2-1-3-15-31/h4-13,18-19,29,32-33H,1-3,14-17H2

Standard InChI Key:  SGLLWAFQFIJSAO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    6.1792   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9000   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542   -3.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1750   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5167   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4667   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9000   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3375   -4.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7167   -2.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6542   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6167   -1.4542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1792   -5.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7542   -5.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8542   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4792   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8167   -3.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4417   -1.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -2.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3792   -1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3167   -5.9625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -2.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0250   -1.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4792   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9792   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2125   -1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0667   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  1  0
  5  2  1  0
  6  1  1  0
  7  6  2  0
  8  2  1  0
  9  5  2  0
 10  3  1  0
 11  6  1  0
 12  4  2  0
 13 26  1  0
 14  7  1  0
 15  7  1  0
 16 10  1  0
 17 10  2  0
 18 12  1  0
 19 21  1  0
 20  9  1  0
 21 11  2  0
 22 23  2  0
 23 17  1  0
 24 16  2  0
 25 22  1  0
 26 29  1  0
 27 19  1  0
 28 18  1  0
 29 25  1  0
 30 13  1  0
 31 13  1  0
 32 31  1  0
 33 30  1  0
 34 32  1  0
  4  5  1  0
  8 14  2  0
 15 19  2  0
 24 22  1  0
 20 18  2  0
 33 34  1  0
M  END

Associated Targets(Human)

ESR2 Tclin Estrogen receptor (3070 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.57Molecular Weight (Monoisotopic): 451.2147AlogP: 6.28#Rotatable Bonds: 5
Polar Surface Area: 52.93Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.56CX Basic pKa: 8.77CX LogP: 5.89CX LogD: 4.78
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.16

References

1. Jones CD, Blaszczak LC, Goettel ME, Suarez T, Crowell TA, Mabry TE, Ruenitz PC, Srivatsan V..  (1992)  Antiestrogens. 3. Estrogen receptor affinities and antiproliferative effects in MCF-7 cells of phenolic analogues of trioxifene, [3,4-dihydro-2-(4- methoxyphenyl)-1-naphthalenyl][4-[2-(1-pyrrolidinyl)ethoxy]- phenyl]methanone.,  35  (5): [PMID:1548683] [10.1021/jm00083a019]

Source