The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Hydroxy-1-methyl-ethyl)-2-{4-[2-(2-hydroxy-3-phenoxy-propylamino)-ethoxy]-phenoxy}-acetamide ID: ALA2113709
PubChem CID: 71461675
Max Phase: Preclinical
Molecular Formula: C22H32N2O7
Molecular Weight: 418.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(CO)NC(=O)COc1ccc(OCCNCC(O)COc2ccccc2)cc1.O
Standard InChI: InChI=1S/C22H30N2O6.H2O/c1-17(14-25)24-22(27)16-30-21-9-7-20(8-10-21)28-12-11-23-13-18(26)15-29-19-5-3-2-4-6-19;/h2-10,17-18,23,25-26H,11-16H2,1H3,(H,24,27);1H2
Standard InChI Key: XCLWTTRYZOAMTP-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
5.6014 -4.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9650 -3.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3768 -2.7682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3768 -4.1924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7238 -2.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5280 -2.7968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1356 -3.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8889 -2.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9521 -2.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2531 -2.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2429 -3.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3877 -2.7682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8074 -3.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4771 -3.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4771 -2.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6535 -3.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6535 -2.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9464 -1.9618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5382 -3.1629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2004 -2.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4358 -3.4831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6728 -3.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1083 -3.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6122 -3.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8176 -2.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0867 -2.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8074 -4.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6122 -2.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0867 -4.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3775 -3.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3775 -4.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 2 2 0
5 7 1 0
6 11 1 0
7 2 1 0
8 5 1 0
9 22 1 0
10 17 1 0
11 9 1 0
12 23 1 0
13 6 1 0
14 8 2 0
15 8 1 0
16 14 1 0
17 15 2 0
18 9 1 0
19 10 1 0
20 3 1 0
21 24 1 0
22 12 1 0
23 25 1 0
24 20 1 0
25 19 1 0
26 13 2 0
27 13 1 0
28 20 1 0
29 27 2 0
30 26 1 0
31 29 1 0
10 16 2 0
31 30 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.49Molecular Weight (Monoisotopic): 418.2104AlogP: 0.97#Rotatable Bonds: 14Polar Surface Area: 109.28Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.38CX Basic pKa: 8.79CX LogP: 0.93CX LogD: -0.47Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.76
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 2. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamides., 35 (10): [PMID:1350310 ] [10.1021/jm00088a010 ]