The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzyl-4-(1-carboxy-ethylcarbamoyl)-5-phenyl-pentanoic acid ID: ALA2114199
PubChem CID: 14557664
Max Phase: Preclinical
Molecular Formula: C22H25NO5
Molecular Weight: 383.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCNC(=O)[C@@H](Cc1ccccc1)C[C@H](Cc1ccccc1)C(=O)O
Standard InChI: InChI=1S/C22H25NO5/c24-20(25)11-12-23-21(26)18(13-16-7-3-1-4-8-16)15-19(22(27)28)14-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,23,26)(H,24,25)(H,27,28)/t18-,19-/m0/s1
Standard InChI Key: JUUGRNXBMBREMY-OALUTQOASA-N
Molfile:
RDKit 2D
28 29 0 0 1 0 0 0 0 0999 V2000
3.0992 -5.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -2.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3840 -4.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -3.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3840 -4.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0673 -5.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3342 -4.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -5.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9536 -4.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0992 -6.1031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3840 -2.3959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0494 -6.1746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8442 -4.8455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9536 -2.3959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5773 -5.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8301 -4.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2384 -3.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -6.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3840 -6.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4589 -4.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2503 -2.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9536 -6.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1741 -3.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4649 -2.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9536 -7.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3840 -7.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6688 -7.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1741 -2.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 6
3 1 1 1
4 5 1 0
5 3 1 0
6 7 1 0
7 15 1 0
8 3 1 0
9 4 1 0
10 1 2 0
11 2 2 0
12 6 2 0
13 1 1 0
14 2 1 0
15 13 1 0
16 6 1 0
17 9 1 0
18 8 1 0
19 18 1 0
20 17 1 0
21 17 2 0
22 18 2 0
23 20 2 0
24 21 1 0
25 22 1 0
26 19 2 0
27 25 2 0
28 24 2 0
26 27 1 0
23 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.44Molecular Weight (Monoisotopic): 383.1733AlogP: 2.77#Rotatable Bonds: 11Polar Surface Area: 103.70Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.95CX Basic pKa: ┄CX LogP: 3.42CX LogD: -2.45Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: -0.04
References 1. Ksander GM, Diefenbacher CG, Yuan AM, Clark F, Sakane Y, Ghai RD.. (1989) Enkephalinase inhibitors. 1. 2,4-Dibenzylglutaric acid derivatives., 32 (12): [PMID:2585440 ] [10.1021/jm00132a005 ]