The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{4-[2-(2-Hydroxy-3-phenoxy-propylamino)-propoxy]-phenoxy}-acetic acid methyl ester HCl ID: ALA2115011
PubChem CID: 71459994
Max Phase: Preclinical
Molecular Formula: C21H29NO7
Molecular Weight: 389.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)COc1ccc(OCC(C)NCC(O)COc2ccccc2)cc1.O
Standard InChI: InChI=1S/C21H27NO6.H2O/c1-16(22-12-17(23)14-27-18-6-4-3-5-7-18)13-26-19-8-10-20(11-9-19)28-15-21(24)25-2;/h3-11,16-17,22-23H,12-15H2,1-2H3;1H2
Standard InChI Key: JAKVTMKNRDQQKS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
7.2188 -3.0643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2125 0.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1875 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7917 -1.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7792 0.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9375 -1.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0625 -1.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3625 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6500 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -0.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0792 -1.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3500 -1.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9375 -0.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7833 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2250 -1.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -1.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0750 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6500 -0.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3625 0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3625 -0.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5042 -1.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6375 0.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7833 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5042 -2.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 -2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2083 -1.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2083 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 22 1 0
5 8 1 0
6 10 1 0
7 13 1 0
8 2 1 0
9 12 1 0
10 19 2 0
11 5 1 0
12 4 1 0
13 9 1 0
14 2 1 0
15 7 1 0
16 6 1 0
17 18 2 0
18 11 1 0
19 20 1 0
20 11 2 0
21 9 1 0
22 16 1 0
23 14 1 0
24 15 2 0
25 15 1 0
26 22 1 0
27 25 2 0
28 24 1 0
29 27 1 0
17 10 1 0
28 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.45Molecular Weight (Monoisotopic): 389.1838AlogP: 2.04#Rotatable Bonds: 12Polar Surface Area: 86.25Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.87CX LogP: 2.35CX LogD: 0.87Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -0.62
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 1. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetates., 35 (10): [PMID:1350309 ] [10.1021/jm00088a009 ]