The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-{2-[2-Hydroxy-3-(4-hydroxy-phenoxy)-propylamino]-ethoxy}-phenoxy)-N-(2-methoxy-ethyl)-acetamide ID: ALA2115018
PubChem CID: 15174977
Max Phase: Preclinical
Molecular Formula: C22H30N2O7
Molecular Weight: 434.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)COc1ccc(OCCNC[C@H](O)COc2ccc(O)cc2)cc1
Standard InChI: InChI=1S/C22H30N2O7/c1-28-12-11-24-22(27)16-31-21-8-6-19(7-9-21)29-13-10-23-14-18(26)15-30-20-4-2-17(25)3-5-20/h2-9,18,23,25-26H,10-16H2,1H3,(H,24,27)/t18-/m0/s1
Standard InChI Key: UGETVXMFKSSLKM-SFHVURJKSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
12.5697 -5.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9769 -6.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9946 -5.0456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3305 -5.0515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1513 -5.0870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7436 -5.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4984 -5.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4314 -5.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5735 -5.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9974 -6.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8579 -5.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8594 -5.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0016 -5.0693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4314 -6.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0794 -4.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7173 -5.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0794 -5.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9974 -5.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7173 -6.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2651 -4.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2651 -5.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5558 -4.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2656 -6.7629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1438 -5.4587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1191 -4.3197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2817 -5.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8444 -5.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7157 -5.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4356 -5.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2693 -4.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5499 -3.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 6 1 0
5 12 1 0
6 1 1 0
7 4 1 0
8 5 1 0
9 26 1 0
10 18 2 0
11 21 2 0
12 9 1 0
13 28 1 0
14 8 1 0
15 7 1 0
16 8 2 0
17 7 2 0
18 16 1 0
19 14 2 0
20 15 2 0
21 17 1 0
9 22 1 1
23 10 1 0
24 11 1 0
25 30 1 0
26 13 1 0
27 3 1 0
28 29 1 0
29 24 1 0
30 27 1 0
31 25 1 0
11 20 1 0
19 10 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.49Molecular Weight (Monoisotopic): 434.2053AlogP: 0.94#Rotatable Bonds: 15Polar Surface Area: 118.51Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.92CX Basic pKa: 8.76CX LogP: 0.60CX LogD: -0.55Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.75
References 1. Howe R, Rao BS, Holloway BR, Stribling D.. (1992) Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 2. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamides., 35 (10): [PMID:1350310 ] [10.1021/jm00088a010 ]