2-(4-{2-[2-Hydroxy-3-(4-hydroxy-phenoxy)-propylamino]-ethoxy}-phenoxy)-N-(2-methoxy-ethyl)-acetamide

ID: ALA2115018

PubChem CID: 15174977

Max Phase: Preclinical

Molecular Formula: C22H30N2O7

Molecular Weight: 434.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCNC(=O)COc1ccc(OCCNC[C@H](O)COc2ccc(O)cc2)cc1

Standard InChI:  InChI=1S/C22H30N2O7/c1-28-12-11-24-22(27)16-31-21-8-6-19(7-9-21)29-13-10-23-14-18(26)15-30-20-4-2-17(25)3-5-20/h2-9,18,23,25-26H,10-16H2,1H3,(H,24,27)/t18-/m0/s1

Standard InChI Key:  UGETVXMFKSSLKM-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   12.5697   -5.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9769   -6.4856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9946   -5.0456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3305   -5.0515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1513   -5.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7436   -5.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4984   -5.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4314   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5735   -5.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9974   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8579   -5.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8594   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0016   -5.0693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4314   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0794   -4.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7173   -5.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0794   -5.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9974   -5.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7173   -6.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2651   -4.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2651   -5.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5558   -4.2549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2656   -6.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1438   -5.4587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1191   -4.3197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2817   -5.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8444   -5.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7157   -5.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4356   -5.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2693   -4.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5499   -3.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  6  1  0
  5 12  1  0
  6  1  1  0
  7  4  1  0
  8  5  1  0
  9 26  1  0
 10 18  2  0
 11 21  2  0
 12  9  1  0
 13 28  1  0
 14  8  1  0
 15  7  1  0
 16  8  2  0
 17  7  2  0
 18 16  1  0
 19 14  2  0
 20 15  2  0
 21 17  1  0
  9 22  1  1
 23 10  1  0
 24 11  1  0
 25 30  1  0
 26 13  1  0
 27  3  1  0
 28 29  1  0
 29 24  1  0
 30 27  1  0
 31 25  1  0
 11 20  1  0
 19 10  1  0
M  END

Associated Targets(non-human)

Adrb3 Beta-3 adrenergic receptor (328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.49Molecular Weight (Monoisotopic): 434.2053AlogP: 0.94#Rotatable Bonds: 15
Polar Surface Area: 118.51Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.92CX Basic pKa: 8.76CX LogP: 0.60CX LogD: -0.55
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.75

References

1. Howe R, Rao BS, Holloway BR, Stribling D..  (1992)  Selective beta 3-adrenergic agonists of brown adipose tissue and thermogenesis. 2. [4-[2-[(2-Hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamides.,  35  (10): [PMID:1350310] [10.1021/jm00088a010]

Source