(Z)-7-[(2S,3S,4S)-4-(Biphenyl-4-ylmethoxy)-1-oxo-2-pyridin-3-yl-tetrahydro-1lambda*4*-thiophen-3-yl]-hept-4-enoic acid

ID: ALA2115559

PubChem CID: 71451008

Max Phase: Preclinical

Molecular Formula: C29H31NO4S

Molecular Weight: 489.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CC/C=C\CC[C@@H]1[C@@H](c2cccnc2)[S@+]([O-])C[C@H]1OCc1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C29H31NO4S/c31-28(32)13-7-2-1-6-12-26-27(21-35(33)29(26)25-11-8-18-30-19-25)34-20-22-14-16-24(17-15-22)23-9-4-3-5-10-23/h1-5,8-11,14-19,26-27,29H,6-7,12-13,20-21H2,(H,31,32)/b2-1-/t26-,27+,29+,35+/m0/s1

Standard InChI Key:  UCHZGYCIIFATFO-DGCUIKEHSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
    6.7474   -5.0141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0800   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4925   -5.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4125   -5.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6675   -5.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5320   -4.7592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0800   -3.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1826   -6.4662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5549   -0.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0634   -9.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3655   -2.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3834   -0.1723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5784   -9.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7278   -8.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8838   -9.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5003   -2.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6718   -3.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5181   -7.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0332   -7.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3395   -1.2342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3688   -8.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2127   -7.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3655   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6279   -4.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9418   -1.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7945   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0800   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4564   -3.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1133   -2.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7580   -9.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9140  -10.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7945   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4291  -11.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2730  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6086  -11.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  1  6  1  6
  2  7  1  1
  5  8  1  1
  9 25  1  0
 10 14  2  0
 11 23  2  0
 12  9  2  0
 13 10  1  0
 14 22  1  0
 15 21  2  0
 16 17  2  0
 17 28  1  0
 18  8  1  0
 19 18  1  0
 20  9  1  0
 21 19  1  0
 22 19  2  0
 23  7  1  0
  4 24  1  6
 25 29  1  0
 26  7  2  0
 27 32  2  0
 28 24  1  0
 29 16  1  0
 30 13  1  0
 31 13  2  0
 32 26  1  0
 33 31  1  0
 34 30  2  0
 35 33  2  0
  4  5  1  0
 11 27  1  0
 10 15  1  0
 35 34  1  0
M  CHG  2   1   1   6  -1
M  END

Associated Targets(Human)

TBXAS1 Tchem Thromboxane-A synthase (3355 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.64Molecular Weight (Monoisotopic): 489.1974AlogP: 5.95#Rotatable Bonds: 11
Polar Surface Area: 82.48Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.23CX Basic pKa: 3.62CX LogP: 3.86CX LogD: 1.20
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: 0.51

References

1. Vlattas I, Dellureficio J, Cohen D, Lee W, Clarke F, Dotson R, Mathis J, Zoganas H.  (1994)  Thia-prostanoid analogs with combined thromboxane receptor antagonist/thromboxane synthase inhibitor activities. Synthesis and pharmacological evaluation,  (17): [10.1016/S0960-894X(01)80103-7]

Source