2-[(E)-2-methoxy-4-methyl-benzenesulfonylimino]-imidazolidine-1-carbodithioic acid 3-thioxo-5,6-dihydro-imidazo[2,1-c][1,2,4]thiadiazol-7-yl ester

ID: ALA211645

PubChem CID: 44412961

Max Phase: Preclinical

Molecular Formula: C16H18N6O3S5

Molecular Weight: 502.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C)ccc1S(=O)(=O)NC1=NCCN1C(=S)SN1CCn2c1nsc2=S

Standard InChI:  InChI=1S/C16H18N6O3S5/c1-10-3-4-12(11(9-10)25-2)30(23,24)19-13-17-5-6-20(13)16(27)29-22-8-7-21-14(22)18-28-15(21)26/h3-4,9H,5-8H2,1-2H3,(H,17,19)

Standard InChI Key:  GETJQJASMIVCCU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.3354   -1.4650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1084   -1.7621    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6288   -1.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3780   -0.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1791   -0.4295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2217    0.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4489    0.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9284    0.0479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4546   -1.1629    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1062    0.0942    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6908    0.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8670    0.8079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1062    1.5214    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3773    1.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5927    1.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5927    0.3961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3773    0.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6352   -0.6427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0479   -1.2298    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.6352   -1.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4642   -0.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4642   -1.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6726   -1.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0892   -2.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3002   -2.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1031   -3.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6834   -2.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7167   -3.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4772   -2.8156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6954   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  8  4  1  0
  3  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  2  0
 19 22  1  0
 22 23  2  0
  1  2  1  0
 23 24  1  0
  2  3  1  0
 24 25  2  0
  3  5  1  0
 25 26  1  0
  4  1  2  0
 26 27  2  0
 27 22  1  0
  4  5  1  0
 25 28  1  0
  5  6  1  0
 27 29  1  0
  6  7  1  0
 29 30  1  0
M  END

Associated Targets(Human)

KYSE-510 (286 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 502.69Molecular Weight (Monoisotopic): 502.0044AlogP: 2.39#Rotatable Bonds: 4
Polar Surface Area: 92.06Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.45CX Basic pKa: 1.60CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -1.58

References

1. Saczewski J, Brzozowski Z, Saczewski F, Bednarski PJ, Liebeke M, Gdaniec M..  (2006)  Synthesis and in vitro anti-tumor activity of N-{1-[(3-thioxo-5,6-dihydroimidazo[2,1-c][1,2,4]thiadiazol-7-ylthio)thiocarbonyl]-2-imidazolidene}arylsulfonamides.,  16  (14): [PMID:16682194] [10.1016/j.bmcl.2006.04.067]

Source