The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((5-(5-chloro-4-hydroxy-2-methoxybenzylidene)-3-methyl-4-oxothiazolidin-2-ylidene)amino)benzoic acid ID: ALA212225
PubChem CID: 44413855
Max Phase: Preclinical
Molecular Formula: C19H15ClN2O5S
Molecular Weight: 418.86
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c(Cl)cc1/C=C1\S/C(=N/c2cccc(C(=O)O)c2)N(C)C1=O
Standard InChI: InChI=1S/C19H15ClN2O5S/c1-22-17(24)16(8-11-7-13(20)14(23)9-15(11)27-2)28-19(22)21-12-5-3-4-10(6-12)18(25)26/h3-9,23H,1-2H3,(H,25,26)/b16-8-,21-19+
Standard InChI Key: ICPWURUZEGNJQW-AYINJXBPSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
1.8780 -12.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0507 -12.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6266 -13.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -14.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8590 -14.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2794 -13.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1983 -13.5950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5993 -12.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2490 -12.1229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8531 -11.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5744 -11.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4156 -12.7716 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.2989 -11.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0029 -11.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7269 -11.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4304 -12.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4103 -12.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6808 -13.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9803 -12.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7536 -10.7421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5607 -11.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6574 -14.0761 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1137 -13.2882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7467 -10.7773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4709 -10.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3029 -12.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1278 -12.2180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9016 -11.4843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
13 14 1 0
3 7 1 0
14 15 2 0
3 4 2 0
15 16 1 0
7 8 2 0
16 17 2 0
8 9 1 0
17 18 1 0
18 19 2 0
19 14 1 0
4 5 1 0
10 20 2 0
2 3 1 0
9 21 1 0
5 6 2 0
18 22 1 0
9 10 1 0
17 23 1 0
10 11 1 0
15 24 1 0
11 12 1 0
24 25 1 0
12 8 1 0
6 1 1 0
11 13 2 0
26 27 1 0
26 28 2 0
1 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.86Molecular Weight (Monoisotopic): 418.0390AlogP: 3.99#Rotatable Bonds: 4Polar Surface Area: 99.43Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.89CX Basic pKa: 2.57CX LogP: 3.71CX LogD: 0.55Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: -1.09
References 1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N.. (2006) Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents., 49 (15): [PMID:16854058 ] [10.1021/jm051296s ]