The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-ethoxy-3-(2-methyl-1-((5-methyl-2-(4-(trifluoromethyl)phenyl)oxazol-4-yl)methyl)-1H-indol-5-yl)propanoic acid ID: ALA212813
PubChem CID: 10096907
Max Phase: Preclinical
Molecular Formula: C26H25F3N2O4
Molecular Weight: 486.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(Cc1ccc2c(c1)cc(C)n2Cc1nc(-c2ccc(C(F)(F)F)cc2)oc1C)C(=O)O
Standard InChI: InChI=1S/C26H25F3N2O4/c1-4-34-23(25(32)33)13-17-5-10-22-19(12-17)11-15(2)31(22)14-21-16(3)35-24(30-21)18-6-8-20(9-7-18)26(27,28)29/h5-12,23H,4,13-14H2,1-3H3,(H,32,33)
Standard InChI Key: VHDZXMLOJYTMRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
7.8863 -5.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8852 -6.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5995 -6.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5979 -5.2257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3126 -5.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3127 -6.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1027 -6.7224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5909 -6.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1026 -5.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3576 -7.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1646 -7.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4985 -8.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3189 -8.3508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4905 -7.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7760 -7.1315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0846 -9.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2202 -7.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9154 -7.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6444 -7.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6761 -6.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9728 -5.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2466 -6.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1717 -5.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1714 -4.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4569 -3.9891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8857 -3.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6036 -4.3998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8886 -3.1627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7425 -4.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0280 -3.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4051 -6.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1139 -5.5879 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8077 -6.7257 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0045 -5.2846 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4159 -6.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
14 17 1 0
7 8 1 0
17 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 2 0
4 1 1 0
20 21 1 0
7 10 1 0
21 22 2 0
22 17 1 0
5 6 1 0
1 23 1 0
10 11 1 0
23 24 1 0
11 12 2 0
24 25 1 0
24 26 1 0
2 3 1 0
3 6 2 0
26 27 1 0
26 28 2 0
1 2 2 0
25 29 1 0
12 13 1 0
29 30 1 0
13 14 1 0
20 31 1 0
14 15 2 0
31 32 1 0
15 11 1 0
31 33 1 0
5 4 2 0
31 34 1 0
12 16 1 0
8 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.49Molecular Weight (Monoisotopic): 486.1766AlogP: 6.01#Rotatable Bonds: 8Polar Surface Area: 77.49Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.07CX Basic pKa: 0.58CX LogP: 5.56CX LogD: 2.44Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.17
References 1. Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Märki HP, Meyer M, Mohr P.. (2006) Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists., 16 (15): [PMID:16737814 ] [10.1016/j.bmcl.2006.05.007 ]