2-ethoxy-3-(2-methyl-1-((5-methyl-2-(4-(trifluoromethyl)phenyl)oxazol-4-yl)methyl)-1H-indol-5-yl)propanoic acid

ID: ALA212813

PubChem CID: 10096907

Max Phase: Preclinical

Molecular Formula: C26H25F3N2O4

Molecular Weight: 486.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(Cc1ccc2c(c1)cc(C)n2Cc1nc(-c2ccc(C(F)(F)F)cc2)oc1C)C(=O)O

Standard InChI:  InChI=1S/C26H25F3N2O4/c1-4-34-23(25(32)33)13-17-5-10-22-19(12-17)11-15(2)31(22)14-21-16(3)35-24(30-21)18-6-8-20(9-7-18)26(27,28)29/h5-12,23H,4,13-14H2,1-3H3,(H,32,33)

Standard InChI Key:  VHDZXMLOJYTMRT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.8863   -5.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8852   -6.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5995   -6.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5979   -5.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3126   -5.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3127   -6.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1027   -6.7224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5909   -6.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1026   -5.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3576   -7.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1646   -7.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4985   -8.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3189   -8.3508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4905   -7.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7760   -7.1315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0846   -9.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2202   -7.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9154   -7.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6444   -7.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6761   -6.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9728   -5.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2466   -6.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1717   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1714   -4.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4569   -3.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8857   -3.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6036   -4.3998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8886   -3.1627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7425   -4.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0280   -3.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4051   -6.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1139   -5.5879    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.8077   -6.7257    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.0045   -5.2846    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4159   -6.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
 14 17  1  0
  7  8  1  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 19 20  2  0
  4  1  1  0
 20 21  1  0
  7 10  1  0
 21 22  2  0
 22 17  1  0
  5  6  1  0
  1 23  1  0
 10 11  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
 24 26  1  0
  2  3  1  0
  3  6  2  0
 26 27  1  0
 26 28  2  0
  1  2  2  0
 25 29  1  0
 12 13  1  0
 29 30  1  0
 13 14  1  0
 20 31  1  0
 14 15  2  0
 31 32  1  0
 15 11  1  0
 31 33  1  0
  5  4  2  0
 31 34  1  0
 12 16  1  0
  8 35  1  0
M  END

Associated Targets(Human)

PPARG Tclin PPAR alpha/gamma (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARD Tchem Peroxisome proliferator-activated receptor delta (6293 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARA Tclin Peroxisome proliferator-activated receptor alpha (9197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.49Molecular Weight (Monoisotopic): 486.1766AlogP: 6.01#Rotatable Bonds: 8
Polar Surface Area: 77.49Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.07CX Basic pKa: 0.58CX LogP: 5.56CX LogD: 2.44
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.17

References

1. Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Märki HP, Meyer M, Mohr P..  (2006)  Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists.,  16  (15): [PMID:16737814] [10.1016/j.bmcl.2006.05.007]

Source