The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID124754947 ID: ALA2132800
PubChem CID: 53300838
Max Phase: Preclinical
Molecular Formula: C26H31F3N2O4
Molecular Weight: 378.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCc1c(-c2cccc(OC)c2)ncn1CCc1ccccc1OC.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C24H30N2O2.C2HF3O2/c1-4-5-6-13-22-24(20-11-9-12-21(17-20)27-2)25-18-26(22)16-15-19-10-7-8-14-23(19)28-3;3-2(4,5)1(6)7/h7-12,14,17-18H,4-6,13,15-16H2,1-3H3;(H,6,7)
Standard InChI Key: PEMVQJVPEOQIFF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
12.1177 -4.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0479 -1.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8489 0.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8327 -3.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7563 -0.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3320 -3.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2556 -0.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0435 -1.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7244 1.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0220 3.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5470 -5.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8975 4.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0432 -3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1355 5.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8783 -0.2942 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8786 0.9056 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.9177 1.5055 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2571 0.1552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2177 -1.6445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9177 0.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2177 -0.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 13 1 0
1 25 1 0
2 18 1 0
2 27 1 0
3 6 1 0
3 8 1 0
3 10 1 0
4 5 1 0
4 8 2 0
5 6 2 0
5 7 1 0
6 9 1 0
7 11 1 0
7 12 2 0
9 19 1 0
10 14 1 0
11 13 2 0
12 16 1 0
13 17 1 0
14 15 1 0
15 18 1 0
15 20 2 0
16 17 2 0
18 21 2 0
19 23 1 0
20 22 1 0
21 24 1 0
22 24 2 0
23 26 1 0
26 28 1 0
29 34 1 0
30 34 1 0
31 34 1 0
32 35 2 0
33 35 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.52Molecular Weight (Monoisotopic): 378.2307AlogP: 5.54#Rotatable Bonds: 10Polar Surface Area: 36.28Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.95CX LogP: 5.87CX LogD: 5.85Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.43Np Likeness Score: -0.72
References 1. PubChem BioAssay data set,