[(Z)-(1S,4S,10S,13R)-10-(3-guanidino-propyl)-3,6,9,12,18-pentaoxo-2,5,8,11,19-pentaaza-bicyclo[11.4.2]nonadec-15-en-4-yl]-acetic acid

ID: ALA213708

PubChem CID: 44414523

Max Phase: Preclinical

Molecular Formula: C20H30N8O7

Molecular Weight: 494.51

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H]1NC(=O)[C@H]2C/C=C\C[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNC1=O)C(=O)N2

Standard InChI:  InChI=1S/C20H30N8O7/c21-20(22)23-7-3-6-10-16(32)24-9-14(29)25-13(8-15(30)31)19(35)28-12-5-2-1-4-11(17(33)26-10)27-18(12)34/h1-2,10-13H,3-9H2,(H,24,32)(H,25,29)(H,26,33)(H,27,34)(H,28,35)(H,30,31)(H4,21,22,23)/b2-1-/t10-,11+,12-,13-/m0/s1

Standard InChI Key:  WIUJKGOJUVUVQN-KWMZTZGHSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  1  0  0  0  0  0999 V2000
    6.1900   -0.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9014    0.0247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3644   -2.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7227   -2.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4996    0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9111   -0.1779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0870   -0.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5049    0.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5049    1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0870    1.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9111    1.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5003    1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1624   -1.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7709   -0.9360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7428    0.0921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6355   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8773   -1.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2903   -1.2225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2226   -0.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7700   -1.8547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4208   -2.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2613   -3.1692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1829   -2.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9192   -2.4952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6976   -2.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5346   -1.3020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4644   -0.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1864   -0.3528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572   -1.6673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5437   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9599   -2.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7808   -2.2080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1929   -1.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0178   -1.4993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7839   -0.7852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6734    0.9635    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4364    0.7578    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 16 18  2  0
  8  9  1  0
 17 19  1  1
  9 10  1  0
 17 20  1  0
 10 11  2  0
 20 21  1  0
 11 12  1  0
 21 22  2  0
  5 12  1  0
 21 23  1  0
  5  1  1  0
 23 24  1  0
  3  4  1  1
 24 25  1  0
 25  3  1  0
  1 13  1  0
 25 26  2  0
  3 13  1  0
 19 27  1  0
  7 14  2  0
 27 28  1  0
  1  2  2  0
 27 29  2  0
  8 15  1  0
  4 30  1  0
  5  6  1  0
 30 31  1  0
 15 16  1  0
 31 32  1  0
  6  7  1  0
 32 33  1  0
 16 17  1  0
 33 34  2  0
  7  8  1  0
 33 35  1  0
  8 36  1  6
  5 37  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA213708

   2-[(1S,4S,10S,13R,15Z)-10-[3-(diaminomethylideneamino)propyl]-3,6,9,12,18-pentaoxo-2,5,8,11,19-pentazabicyclo[11.4.2]nonadec-15-en-4-yl]acetic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 494.51

Molecular Weight (Monoisotopic): 494.2237

AlogP: -3.86

#Rotatable Bonds: 6

Polar Surface Area: 244.70

Molecular Species: ZWITTERION

HBA: 7

HBD: 9

#RO5 Violations: 1

HBA (Lipinski): 15

HBD (Lipinski): 10

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.94

CX Basic pKa: 12.57

CX LogP: -6.23

CX LogD: -6.23

Aromatic Rings: ┄

Heavy Atoms: 35

QED Weighted: 0.08

Np Likeness Score: 1.02

References

1. Creighton CJ, Du Y, Santulli RJ, Tounge BA, Reitz AB..  (2006)  Synthesis and biological evaluation of type VI beta-turn templated RGD peptidomimetics.,  16  (15): [PMID:16750627] [10.1016/j.bmcl.2006.05.020]

Source

Source(1):

• Scientific Literature