2-ethoxy-3-(1-((5-methyl-2-phenyloxazol-4-yl)methyl)-1H-indol-4-yl)propanoic acid

ID: ALA213782

PubChem CID: 11741962

Max Phase: Preclinical

Molecular Formula: C24H24N2O4

Molecular Weight: 404.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(Cc1cccc2c1ccn2Cc1nc(-c2ccccc2)oc1C)C(=O)O

Standard InChI:  InChI=1S/C24H24N2O4/c1-3-29-22(24(27)28)14-18-10-7-11-21-19(18)12-13-26(21)15-20-16(2)30-23(25-20)17-8-5-4-6-9-17/h4-13,22H,3,14-15H2,1-2H3,(H,27,28)

Standard InChI Key:  KOXPFQLGGZYKBZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    8.8322   -0.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8311   -1.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5455   -1.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5438    0.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2585   -0.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2586   -1.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0486   -1.4146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5369   -0.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0485   -0.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3036   -2.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1106   -2.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4445   -3.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2650   -3.0433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4365   -2.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7220   -1.8239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0306   -3.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1901   -1.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8543   -2.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6073   -2.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6940   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0215   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2711   -1.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5414    0.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8259    1.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8235    2.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1125    0.9030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1148    0.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4015   -0.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5370    2.5585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1080    2.5545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
  5  4  2  0
 12 16  1  0
  6  7  1  0
 14 17  1  0
  7  8  1  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 19 20  2  0
  4  1  1  0
 20 21  1  0
  7 10  1  0
 21 22  2  0
 22 17  1  0
  5  6  1  0
  4 23  1  0
 10 11  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
 24 26  1  0
  2  3  1  0
 26 27  1  0
  3  6  2  0
 27 28  1  0
  1  2  2  0
 12 13  1  0
 25 29  1  0
 25 30  2  0
M  END

Associated Targets(Human)

PPARG Tclin PPAR alpha/gamma (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARD Tchem Peroxisome proliferator-activated receptor delta (6293 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARA Tclin Peroxisome proliferator-activated receptor alpha (9197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.47Molecular Weight (Monoisotopic): 404.1736AlogP: 4.69#Rotatable Bonds: 8
Polar Surface Area: 77.49Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.76CX Basic pKa: 0.58CX LogP: 4.48CX LogD: 1.20
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -0.98

References

1. Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Märki HP, Meyer M, Mohr P..  (2006)  Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists.,  16  (15): [PMID:16737814] [10.1016/j.bmcl.2006.05.007]

Source