The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49822108 ID: ALA2138095
PubChem CID: 7935369
Max Phase: Preclinical
Molecular Formula: C20H24FNO4
Molecular Weight: 361.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCC(=O)NCCc2ccc(F)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C20H24FNO4/c1-24-17-12-15(13-18(25-2)20(17)26-3)6-9-19(23)22-11-10-14-4-7-16(21)8-5-14/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,22,23)
Standard InChI Key: JFQCGDCJEMSUQW-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
-3.9150 13.9491 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 5.9988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9149 9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 -3.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9149 12.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2139 10.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6158 10.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 8.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2139 11.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6159 11.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6109 7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 20 1 0
2 7 1 0
2 17 1 0
3 8 1 0
3 18 1 0
4 9 1 0
4 19 1 0
5 15 2 0
6 15 1 0
6 26 1 0
7 8 2 0
7 9 1 0
8 11 1 0
9 12 2 0
10 11 2 0
10 12 1 0
10 13 1 0
13 14 1 0
14 15 1 0
16 21 2 0
16 22 1 0
16 23 1 0
20 24 2 0
20 25 1 0
21 24 1 0
22 25 2 0
23 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.41Molecular Weight (Monoisotopic): 361.1689AlogP: 3.14#Rotatable Bonds: 9Polar Surface Area: 56.79Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.16CX LogD: 3.16Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.75Np Likeness Score: -0.54
References 1. PubChem BioAssay data set,