SID49672553

ID: ALA2139637

PubChem CID: 2443198

Max Phase: Preclinical

Molecular Formula: C15H18N2O4S

Molecular Weight: 322.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)c(C)o1

Standard InChI:  InChI=1S/C15H18N2O4S/c1-10-9-14(11(2)21-10)15(18)17-8-7-12-3-5-13(6-4-12)22(16,19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H2,16,19,20)

Standard InChI Key:  UGQAZCRQMBIGMG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   -2.5988    1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.7945   -7.8036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8509   -5.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3273   -7.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5408   -5.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5445   -6.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4307   -8.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7379   -6.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  2  0
  1  7  1  0
  1  9  1  0
  2 10  1  0
  2 13  1  0
  5 11  2  0
  6 11  1  0
  6 20  1  0
  8 10  2  0
  8 11  1  0
  8 12  1  0
  9 15  2  0
  9 16  1  0
 10 21  1  0
 12 13  2  0
 13 22  1  0
 14 17  2  0
 14 18  1  0
 14 19  1  0
 15 17  1  0
 16 18  2  0
 19 20  1  0
M  END

Alternative Forms

Associated Targets(Human)

WRN Tbio Werner syndrome ATP-dependent helicase (8824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TARDBP Tchem TAR DNA-binding protein 43 (40113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.39Molecular Weight (Monoisotopic): 322.0987AlogP: 1.52#Rotatable Bonds: 5
Polar Surface Area: 102.40Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.22CX Basic pKa: CX LogP: 1.21CX LogD: 1.21
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.87Np Likeness Score: -1.50

References

1. PubChem BioAssay data set, 

Source

Source(1):