The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID57262035 ID: ALA2141816
PubChem CID: 5080922
Max Phase: Preclinical
Molecular Formula: C24H29ClN2O9S
Molecular Weight: 557.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCC(=O)OCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc(OC)c1OC
Standard InChI: InChI=1S/C24H29ClN2O9S/c1-32-20-12-16(13-21(33-2)24(20)34-3)4-7-23(29)36-15-22(28)26-19-14-17(5-6-18(19)25)37(30,31)27-8-10-35-11-9-27/h5-6,12-14H,4,7-11,15H2,1-3H3,(H,26,28)
Standard InChI Key: HTQIELOGNQEJPG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
-4.1838 12.6012 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-9.1110 9.7336 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-10.1521 10.3304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1150 10.9336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0983 5.2328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 5.9988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9499 7.6463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1068 8.2328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9149 9.7490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8138 10.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5122 9.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2157 10.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8190 11.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2210 11.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5226 12.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4037 7.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8056 7.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3994 5.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8014 5.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 8.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6109 7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 -3.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 18 1 0
2 3 2 0
2 4 2 0
2 12 1 0
2 14 1 0
5 28 1 0
5 29 1 0
6 22 1 0
6 35 1 0
7 23 1 0
7 36 1 0
8 24 1 0
8 37 1 0
9 32 1 0
9 34 1 0
10 30 2 0
11 34 2 0
12 20 1 0
12 21 1 0
13 16 1 0
13 30 1 0
14 15 1 0
14 17 2 0
15 16 2 0
16 18 1 0
17 19 1 0
18 19 2 0
20 28 1 0
21 29 1 0
22 23 2 0
22 24 1 0
23 26 1 0
24 27 2 0
25 26 2 0
25 27 1 0
25 31 1 0
30 32 1 0
31 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 557.02Molecular Weight (Monoisotopic): 556.1282AlogP: 2.50#Rotatable Bonds: 11Polar Surface Area: 129.70Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.58CX Basic pKa: ┄CX LogP: 2.08CX LogD: 2.08Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.46
References 1. PubChem BioAssay data set,