The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(1-(((3S)-2-hydroxy-5-oxo-tetrahydrofuran-3-yl)carbamoyl)cyclohexanecarbonyl)-3-methoxybenzohydrazide ID: ALA214215
PubChem CID: 44414574
Max Phase: Preclinical
Molecular Formula: C20H25N3O7
Molecular Weight: 419.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C(=O)NNC(=O)C2(C(=O)N[C@H]3CC(=O)OC3O)CCCCC2)c1
Standard InChI: InChI=1S/C20H25N3O7/c1-29-13-7-5-6-12(10-13)16(25)22-23-19(28)20(8-3-2-4-9-20)18(27)21-14-11-15(24)30-17(14)26/h5-7,10,14,17,26H,2-4,8-9,11H2,1H3,(H,21,27)(H,22,25)(H,23,28)/t14-,17?/m0/s1
Standard InChI Key: WWJJTCYWVNPFIZ-MBIQTGHCSA-N
Molfile:
RDKit 2D
30 32 0 0 1 0 0 0 0 0999 V2000
11.7860 -5.2036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0745 -5.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5021 -5.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2180 -5.2027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5021 -6.4402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0745 -6.4402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9311 -5.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2153 -5.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9311 -4.3765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9297 -5.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0180 -6.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8240 -6.6037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2366 -5.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6834 -5.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0589 -5.7986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4057 -6.9844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5048 -6.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2172 -6.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4995 -5.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7809 -6.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7843 -5.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0740 -3.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0740 -4.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4980 -4.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4980 -3.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7860 -3.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5083 -7.6724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2248 -8.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3597 -5.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6449 -5.6152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
14 10 1 0
13 15 2 0
11 16 1 0
8 19 2 0
20 17 1 0
2 1 1 0
17 18 2 0
18 8 1 0
1 3 1 0
21 19 1 0
3 4 1 0
3 5 2 0
20 21 2 0
22 23 1 0
2 6 2 0
7 8 1 0
22 26 1 0
23 1 1 0
1 24 1 0
24 25 1 0
25 26 1 0
7 9 2 0
10 4 1 1
27 28 1 0
17 27 1 0
10 11 1 0
11 12 1 0
2 29 1 0
29 30 1 0
30 7 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.43Molecular Weight (Monoisotopic): 419.1693AlogP: 0.16#Rotatable Bonds: 5Polar Surface Area: 143.06Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.43CX Basic pKa: ┄CX LogP: 0.74CX LogD: 0.74Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -0.42
References 1. Soper DL, Sheville J, O'Neil SV, Wang Y, Laufersweiler MC, Oppong KA, Wos JA, Ellis CD, Fancher AN, Lu W, Suchanek MK, Wang RL, De B, Demuth TP.. (2006) Synthesis and evaluation of novel 1-(2-acylhydrazinocarbonyl)-cycloalkyl carboxamides as interleukin-1beta converting enzyme (ICE) inhibitors., 16 (16): [PMID:16782334 ] [10.1016/j.bmcl.2006.05.076 ]