SID57268011

ID: ALA2142839

PubChem CID: 16277334

Max Phase: Preclinical

Molecular Formula: C21H19N3O8S2

Molecular Weight: 505.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(c1ccc(OCC(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1)S(=O)(=O)c1cccs1

Standard InChI:  InChI=1S/C21H19N3O8S2/c1-23(34(29,30)21-3-2-12-33-21)16-8-10-18(11-9-16)31-14-20(26)32-13-19(25)22-15-4-6-17(7-5-15)24(27)28/h2-12H,13-14H2,1H3,(H,22,25)

Standard InChI Key:  NEZCLPYBPNJJSB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    1.4273   -1.6521    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.8852   -1.7263    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.8562   -1.3213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8551   -1.9812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4302    0.8237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5744    0.4075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8613    1.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0033   -0.2550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1464   -0.5171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5699   -1.5041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4285   -0.8267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7202    0.8163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5731   -0.8441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155   -2.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0006   -0.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4360   -2.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0220   -3.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4344    0.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8605   -0.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1444    0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1504    0.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4316   -0.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8634    0.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1447   -0.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8602    0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0044    0.4050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2902    0.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0
  1  4  2  0
  1 11  1  0
  1 14  1  0
  2 14  1  0
  2 21  1  0
  5 20  1  0
  5 27  1  0
  6 32  1  0
  6 34  1  0
  7 32  2  0
  8 33  2  0
  9 13  1  0
 10 13  2  0
 11 15  1  0
 11 19  1  0
 12 25  1  0
 12 33  1  0
 13 26  1  0
 14 16  2  0
 15 17  2  0
 15 18  1  0
 16 22  1  0
 17 23  1  0
 18 24  2  0
 20 23  2  0
 20 24  1  0
 21 22  2  0
 25 28  2  0
 25 29  1  0
 26 30  2  0
 26 31  1  0
 27 32  1  0
 28 30  1  0
 29 31  2  0
 33 34  1  0
M  CHG  2   9  -1  13   1
M  END

Associated Targets(Human)

WRN Tbio Werner syndrome ATP-dependent helicase (8824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.53Molecular Weight (Monoisotopic): 505.0614AlogP: 3.04#Rotatable Bonds: 10
Polar Surface Area: 145.15Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.07CX Basic pKa: CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -2.25

References

1. PubChem BioAssay data set, 

Source

Source(1):