2-chloro-N-(4-(5-pivalamido-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA214374

PubChem CID: 44416424

Max Phase: Preclinical

Molecular Formula: C25H23ClN4O2

Molecular Weight: 446.94

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C(=O)Nc1ccc2[nH]c(-c3ccc(NC(=O)c4ccccc4Cl)cc3)nc2c1

Standard InChI:  InChI=1S/C25H23ClN4O2/c1-25(2,3)24(32)28-17-12-13-20-21(14-17)30-22(29-20)15-8-10-16(11-9-15)27-23(31)18-6-4-5-7-19(18)26/h4-14H,1-3H3,(H,27,31)(H,28,32)(H,29,30)

Standard InChI Key:  WPWODYUMTXQMLE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    0.2600   -4.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6609   -4.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4850   -4.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9083   -4.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5014   -3.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6785   -3.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5649   -4.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4047   -3.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6895   -3.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6883   -4.4466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9757   -3.2079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2606   -3.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2640   -4.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5497   -4.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5537   -3.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0548   -3.3507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8389   -3.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8324   -4.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0434   -4.6859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7332   -4.0553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1367   -4.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9616   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7152   -5.4841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3630   -5.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1872   -5.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6095   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2016   -4.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3788   -4.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9724   -3.3588    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.1250   -2.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9933   -2.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8108   -3.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  3  4  1  0
  8  9  1  0
  4  5  2  0
 16 17  1  0
 18 19  1  0
 19  7  1  0
  7 16  2  0
  9 10  2  0
  4 20  1  0
  2  3  2  0
 20 21  1  0
  9 11  1  0
 21 22  1  0
  5  6  1  0
 21 23  2  0
 11 12  1  0
 22 24  2  0
  6  1  2  0
 24 25  1  0
 12 13  2  0
 25 26  2  0
  1  2  1  0
 26 27  1  0
 13 14  1  0
 27 28  2  0
 28 22  1  0
 14 18  2  0
 28 29  1  0
  1  7  1  0
  8 30  1  0
 17 15  2  0
  8 31  1  0
 15 12  1  0
  8 32  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.94Molecular Weight (Monoisotopic): 446.1510AlogP: 6.12#Rotatable Bonds: 4
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.55CX Basic pKa: 5.16CX LogP: 6.02CX LogD: 6.02
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.67

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source