SID845465

ID: ALA2144092

PubChem CID: 647816

Max Phase: Preclinical

Molecular Formula: C11H17N5O3

Molecular Weight: 267.29

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCNc1nnc(O)nc1O)N1CCCCC1

Standard InChI:  InChI=1S/C11H17N5O3/c17-8(16-6-2-1-3-7-16)4-5-12-9-10(18)13-11(19)15-14-9/h1-7H2,(H,12,14)(H2,13,15,18,19)

Standard InChI Key:  SADJMAKSZWYUNI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8509    5.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894    6.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8912    5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933    3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1895    7.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4886    5.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4885    8.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876    6.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876    7.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  2 11  1  0
  3 12  2  0
  4 10  2  0
  4 11  1  0
  5  7  1  0
  5  9  2  0
  6  9  1  0
  6 13  1  0
  7 11  2  0
  8 12  1  0
  8 15  1  0
  8 16  1  0
  9 10  1  0
 12 14  1  0
 13 14  1  0
 15 17  1  0
 16 18  1  0
 17 19  1  0
 18 19  1  0
M  END

Associated Targets(Human)

CGA Tbio Glycoprotein hormones alpha chain (29278 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.29Molecular Weight (Monoisotopic): 267.1331AlogP: 0.10#Rotatable Bonds: 4
Polar Surface Area: 111.47Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.28CX Basic pKa: 2.61CX LogP: 0.01CX LogD: 0.01
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.71Np Likeness Score: -1.32

References

1. PubChem BioAssay data set, 

Source

Source(1):